2-[2-(Boc-L-alanyl)aminothaizol-4-yl]-2-methoxyimino acetic acid structure
|
Common Name | 2-[2-(Boc-L-alanyl)aminothaizol-4-yl]-2-methoxyimino acetic acid | ||
|---|---|---|---|---|
| CAS Number | 88970-81-4 | Molecular Weight | 372.39700 | |
| Density | 1.4 | Boiling Point | N/A | |
| Molecular Formula | C14H20N4O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[2-(Boc-L-alanyl)aminothaizol-4-yl]-2-methoxyimino acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4 |
|---|---|
| Molecular Formula | C14H20N4O6S |
| Molecular Weight | 372.39700 |
| Exact Mass | 372.11000 |
| PSA | 167.45000 |
| LogP | 1.89380 |
| Index of Refraction | 1.594 |
| InChIKey | GGQBZAQDZRIQNC-UHFFFAOYSA-N |
| SMILES | CON=C(C(=O)O)c1csc(NC(=O)C(C)NC(=O)OC(C)(C)C)n1 |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| BAAA |
| BOC-L-alanyl oxamidine acid |
| MFCD08460142 |