3-nitro-9-propylcarbazole structure
|
Common Name | 3-nitro-9-propylcarbazole | ||
|---|---|---|---|---|
| CAS Number | 88974-78-1 | Molecular Weight | 254.28400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-nitro-9-propylcarbazole |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H14N2O2 |
|---|---|
| Molecular Weight | 254.28400 |
| Exact Mass | 254.10600 |
| PSA | 50.75000 |
| LogP | 4.63590 |
| InChIKey | YSEVDCXBGNKZPV-UHFFFAOYSA-N |
| SMILES | CCCn1c2ccccc2c2cc([N+](=O)[O-])ccc21 |
|
~%
3-nitro-9-propy... CAS#:88974-78-1 |
| Literature: Stevens; Tucker Journal of the Chemical Society, 1923 , vol. 123, p. 2147 |
|
~%
3-nitro-9-propy... CAS#:88974-78-1 |
| Literature: Stevens; Tucker Journal of the Chemical Society, 1923 , vol. 123, p. 2147 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3-nitro-9-propyl-carbazole |
| 9H-Carbazole,3-nitro-9-propyl |