diethyl 2-methyl-2-[4-(methylamino)phenyl]propanedioate
![diethyl 2-methyl-2-[4-(methylamino)phenyl]propanedioate Structure](https://image.chemsrc.com/caspic/146/88975-18-2.png)
diethyl 2-methyl-2-[4-(methylamino)phenyl]propanedioate structure
|
Common Name | diethyl 2-methyl-2-[4-(methylamino)phenyl]propanedioate | ||
|---|---|---|---|---|
| CAS Number | 88975-18-2 | Molecular Weight | 279.33200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | diethyl 2-methyl-2-[4-(methylamino)phenyl]propanedioate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H21NO4 |
|---|---|
| Molecular Weight | 279.33200 |
| Exact Mass | 279.14700 |
| PSA | 64.63000 |
| LogP | 2.18520 |
| InChIKey | RKSYOHOLOJPYKJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)(C(=O)OCC)c1ccc(NC)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
diethyl 2-methy... CAS#:88975-18-2 |
| Literature: Maeda; Ohsugi; Fujioka; Hirose Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 10 p. 3424 - 3445 |
|
~%
diethyl 2-methy... CAS#:88975-18-2 |
| Literature: Maeda; Ohsugi; Fujioka; Hirose Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 10 p. 3424 - 3445 |
![diethyl 2-[(4-aminophenyl)methyl]propanedioate structure](https://image.chemsrc.com/caspic/228/61881-50-3.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Propanedioic acid,methyl[4-(methylamino)phenyl]-,diethyl ester |
| diethyl (4-methylaminophenyl)methylmalonate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of diethyl 2-methyl-2-[4-(methylamino)phenyl]propanedioate? |
| A: The English name of diethyl 2-methyl-2-[4-(methylamino)phenyl]propanedioate is diethyl 2-methyl-2-[4-(methylamino)phenyl]propanedioate. |
| Q: What is the LogP of diethyl 2-methyl-2-[4-(methylamino)phenyl]propanedioate? |
| A: LogP of diethyl 2-methyl-2-[4-(methylamino)phenyl]propanedioate is 2.18520. |
| Q: What is the CAS number of diethyl 2-methyl-2-[4-(methylamino)phenyl]propanedioate? |
| A: CAS number of diethyl 2-methyl-2-[4-(methylamino)phenyl]propanedioate is 88975-18-2. |
| Q: What is the SMILES notation of diethyl 2-methyl-2-[4-(methylamino)phenyl]propanedioate? |
| A: SMILES notation of diethyl 2-methyl-2-[4-(methylamino)phenyl]propanedioate is CCOC(=O)C(C)(C(=O)OCC)c1ccc(NC)cc1. |
| Q: What is the molecular formula of diethyl 2-methyl-2-[4-(methylamino)phenyl]propanedioate? |
| A: Molecular formula of diethyl 2-methyl-2-[4-(methylamino)phenyl]propanedioate is C15H21NO4. |
| Q: What are the upstream materials of diethyl 2-methyl-2-[4-(methylamino)phenyl]propanedioate? |
| A: Related upstream materials(CAS) of diethyl 2-methyl-2-[4-(methylamino)phenyl]propanedioate: 61881-50-3. |
| Q: What is the polar surface area (PSA) of diethyl 2-methyl-2-[4-(methylamino)phenyl]propanedioate? |
| A: Polar surface area (PSA) of diethyl 2-methyl-2-[4-(methylamino)phenyl]propanedioate is 64.63000. |
| Q: What is the InChIKey of diethyl 2-methyl-2-[4-(methylamino)phenyl]propanedioate? |
| A: InChIKey of diethyl 2-methyl-2-[4-(methylamino)phenyl]propanedioate is RKSYOHOLOJPYKJ-UHFFFAOYSA-N. |
| Q: What English synonyms does diethyl 2-methyl-2-[4-(methylamino)phenyl]propanedioate have? |
| A: English synonyms of diethyl 2-methyl-2-[4-(methylamino)phenyl]propanedioate: Propanedioic acid,methyl[4-(methylamino)phenyl]-,diethyl ester, diethyl (4-methylaminophenyl)methylmalonate. |
| Q: What is the molecular weight of diethyl 2-methyl-2-[4-(methylamino)phenyl]propanedioate? |
| A: Molecular weight of diethyl 2-methyl-2-[4-(methylamino)phenyl]propanedioate is 279.33200. |