diethyl 2-[(3,5-dichloro-4-hydroxyphenyl)methyl]propanedioate
Modify Date: 2026-07-10 12:42:09
![diethyl 2-[(3,5-dichloro-4-hydroxyphenyl)methyl]propanedioate Structure](https://image.chemsrc.com/caspic/101/88975-46-6.png)
diethyl 2-[(3,5-dichloro-4-hydroxyphenyl)methyl]propanedioate structure
|
Common Name | diethyl 2-[(3,5-dichloro-4-hydroxyphenyl)methyl]propanedioate | ||
|---|---|---|---|---|
| CAS Number | 88975-46-6 | Molecular Weight | 335.18000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16Cl2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diethyl 2-[(3,5-dichloro-4-hydroxyphenyl)methyl]propanedioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H16Cl2O5 |
|---|---|
| Molecular Weight | 335.18000 |
| Exact Mass | 334.03700 |
| PSA | 72.83000 |
| LogP | 2.98390 |
| InChIKey | PJFRHGUSQKWLSP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(Cc1cc(Cl)c(O)c(Cl)c1)C(=O)OCC |
|
~89%
diethyl 2-[(3,5... CAS#:88975-46-6 |
| Literature: Maeda; Ohsugi; Fujioka; Hirose Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 10 p. 3424 - 3445 |
|
~%
diethyl 2-[(3,5... CAS#:88975-46-6 |
| Literature: Maeda; Ohsugi; Fujioka; Hirose Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 10 p. 3424 - 3445 |
![diethyl 2-[(4-hydroxyphenyl)methyl]propanedioate structure](https://image.chemsrc.com/caspic/259/76510-82-2.png)
![diethyl 2-[(4-aminophenyl)methyl]propanedioate structure](https://image.chemsrc.com/caspic/228/61881-50-3.png)
| Precursor 2 | |
|---|---|
| DownStream 1 | |
![diethyl 2-[(3,5-dichloro-4-cyanatophenyl)methyl]propanedioate structure](https://image.chemsrc.com/caspic/246/88975-91-1.png)
CAS#:88975-91-1| diethyl (3,5-dichloro-4-hydroxyphenyl)methylmalonate |
| Propanedioic acid,(3,5-dichloro-4-hydroxyphenyl)methyl-,diethyl ester |