N-[[2-(cyanomethyl)phenyl]methylcarbamothioyl]benzamide
![N-[[2-(cyanomethyl)phenyl]methylcarbamothioyl]benzamide Structure](https://image.chemsrc.com/caspic/008/88975-75-1.png)
N-[[2-(cyanomethyl)phenyl]methylcarbamothioyl]benzamide structure
|
Common Name | N-[[2-(cyanomethyl)phenyl]methylcarbamothioyl]benzamide | ||
|---|---|---|---|---|
| CAS Number | 88975-75-1 | Molecular Weight | 309.38600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H15N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-[[2-(cyanomethyl)phenyl]methylcarbamothioyl]benzamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H15N3OS |
|---|---|
| Molecular Weight | 309.38600 |
| Exact Mass | 309.09400 |
| PSA | 107.54000 |
| LogP | 3.54328 |
| InChIKey | DMEYGYBAWBMGTR-UHFFFAOYSA-N |
| SMILES | N#CCc1ccccc1CNC(=S)NC(=O)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~92%
N-[[2-(cyanomet... CAS#:88975-75-1 |
| Literature: Maeda; Ohsugi; Fujioka; Hirose Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 10 p. 3424 - 3445 |
|
~%
N-[[2-(cyanomet... CAS#:88975-75-1 |
| Literature: Maeda; Ohsugi; Fujioka; Hirose Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 10 p. 3424 - 3445 |
![2-[2-(methylamino)phenyl]acetonitrile structure](https://image.chemsrc.com/caspic/053/88975-25-1.png)
![N-[2-(cyanomethyl)phenyl]-2,2,2-trifluoroacetamide structure](https://image.chemsrc.com/caspic/308/88975-36-4.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 1 | |
![2-[2-[methyl(1,3-thiazol-2-yl)amino]phenyl]acetic acid structure](https://image.chemsrc.com/caspic/001/88975-80-8.png)
CAS#:88975-80-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Benzamide,N-[[[2-(cyanomethyl)phenyl]methylamino]thioxomethyl] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of N-[[2-(cyanomethyl)phenyl]methylcarbamothioyl]benzamide? |
| A: LogP of N-[[2-(cyanomethyl)phenyl]methylcarbamothioyl]benzamide is 3.54328. |
| Q: What is the CAS number of N-[[2-(cyanomethyl)phenyl]methylcarbamothioyl]benzamide? |
| A: CAS number of N-[[2-(cyanomethyl)phenyl]methylcarbamothioyl]benzamide is 88975-75-1. |
| Q: What is the InChIKey of N-[[2-(cyanomethyl)phenyl]methylcarbamothioyl]benzamide? |
| A: InChIKey of N-[[2-(cyanomethyl)phenyl]methylcarbamothioyl]benzamide is DMEYGYBAWBMGTR-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 88975-75-1? |
| A: Chinese name of 88975-75-1 is 88975-75-1. |
| Q: What is the English name of N-[[2-(cyanomethyl)phenyl]methylcarbamothioyl]benzamide? |
| A: The English name of N-[[2-(cyanomethyl)phenyl]methylcarbamothioyl]benzamide is N-[[2-(cyanomethyl)phenyl]methylcarbamothioyl]benzamide. |
| Q: What is the molecular weight of N-[[2-(cyanomethyl)phenyl]methylcarbamothioyl]benzamide? |
| A: Molecular weight of N-[[2-(cyanomethyl)phenyl]methylcarbamothioyl]benzamide is 309.38600. |
| Q: What are the downstream products of N-[[2-(cyanomethyl)phenyl]methylcarbamothioyl]benzamide? |
| A: Related downstream products(CAS) of N-[[2-(cyanomethyl)phenyl]methylcarbamothioyl]benzamide: 88975-80-8. |
| Q: What is the polar surface area (PSA) of N-[[2-(cyanomethyl)phenyl]methylcarbamothioyl]benzamide? |
| A: Polar surface area (PSA) of N-[[2-(cyanomethyl)phenyl]methylcarbamothioyl]benzamide is 107.54000. |
| Q: What English synonyms does N-[[2-(cyanomethyl)phenyl]methylcarbamothioyl]benzamide have? |
| A: English synonyms of N-[[2-(cyanomethyl)phenyl]methylcarbamothioyl]benzamide: Benzamide,N-[[[2-(cyanomethyl)phenyl]methylamino]thioxomethyl]. |
| Q: What is the molecular formula of N-[[2-(cyanomethyl)phenyl]methylcarbamothioyl]benzamide? |
| A: Molecular formula of N-[[2-(cyanomethyl)phenyl]methylcarbamothioyl]benzamide is C17H15N3OS. |