N-[[2-(cyanomethyl)phenyl]methylcarbamothioyl]benzamide structure
|
Common Name | N-[[2-(cyanomethyl)phenyl]methylcarbamothioyl]benzamide | ||
|---|---|---|---|---|
| CAS Number | 88975-75-1 | Molecular Weight | 309.38600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H15N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[[2-(cyanomethyl)phenyl]methylcarbamothioyl]benzamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H15N3OS |
|---|---|
| Molecular Weight | 309.38600 |
| Exact Mass | 309.09400 |
| PSA | 107.54000 |
| LogP | 3.54328 |
| InChIKey | DMEYGYBAWBMGTR-UHFFFAOYSA-N |
| SMILES | N#CCc1ccccc1CNC(=S)NC(=O)c1ccccc1 |
|
~92%
N-[[2-(cyanomet... CAS#:88975-75-1 |
| Literature: Maeda; Ohsugi; Fujioka; Hirose Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 10 p. 3424 - 3445 |
|
~%
N-[[2-(cyanomet... CAS#:88975-75-1 |
| Literature: Maeda; Ohsugi; Fujioka; Hirose Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 10 p. 3424 - 3445 |
| Benzamide,N-[[[2-(cyanomethyl)phenyl]methylamino]thioxomethyl] |