diethyl 2-[(4-cyanatophenyl)methyl]propanedioate structure
|
Common Name | diethyl 2-[(4-cyanatophenyl)methyl]propanedioate | ||
|---|---|---|---|---|
| CAS Number | 88975-83-1 | Molecular Weight | 291.29900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H17NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diethyl 2-[(4-cyanatophenyl)methyl]propanedioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H17NO5 |
|---|---|
| Molecular Weight | 291.29900 |
| Exact Mass | 291.11100 |
| PSA | 85.62000 |
| LogP | 1.83138 |
| InChIKey | QBCCLPHNPMHHFT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(Cc1ccc(OC#N)cc1)C(=O)OCC |
|
~%
diethyl 2-[(4-c... CAS#:88975-83-1 |
| Literature: Maeda; Ohsugi; Fujioka; Hirose Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 10 p. 3424 - 3445 |
|
~%
diethyl 2-[(4-c... CAS#:88975-83-1 |
| Literature: Maeda; Ohsugi; Fujioka; Hirose Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 10 p. 3424 - 3445 |
| Propanedioic acid,(4-cyanatophenyl)methyl-,diethyl ester |