N-hydroxy-4-methyl-N-(trifluoromethyl)benzenesulfonamide structure
|
Common Name | N-hydroxy-4-methyl-N-(trifluoromethyl)benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 88978-52-3 | Molecular Weight | 255.21400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8F3NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-hydroxy-4-methyl-N-(trifluoromethyl)benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H8F3NO3S |
|---|---|
| Molecular Weight | 255.21400 |
| Exact Mass | 255.01800 |
| PSA | 65.99000 |
| LogP | 2.97550 |
| InChIKey | NWJYQQZLQSQYBJ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)N(O)C(F)(F)F)cc1 |
|
~88%
N-hydroxy-4-met... CAS#:88978-52-3 |
| Literature: Sekiya, Akira; Umemoto, Teruo Bulletin of the Chemical Society of Japan, 1984 , vol. 57, # 10 p. 2962 - 2964 |
|
~96%
N-hydroxy-4-met... CAS#:88978-52-3 |
| Literature: Sekiya, Akira; Umemoto, Teruo Bulletin of the Chemical Society of Japan, 1984 , vol. 57, # 10 p. 2962 - 2964 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N-trifluoromethyl-N-hydroxy-p-toluenesulfonamide |
| Benzenesulfonamide,N-hydroxy-4-methyl-N-(trifluoromethyl) |