1,1,1,4,4,4-hexafluoro-3,3-bis(trifluoromethyl)butan-2-one structure
|
Common Name | 1,1,1,4,4,4-hexafluoro-3,3-bis(trifluoromethyl)butan-2-one | ||
|---|---|---|---|---|
| CAS Number | 88995-83-9 | Molecular Weight | 316.04400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6F12O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1,1,4,4,4-hexafluoro-3,3-bis(trifluoromethyl)butan-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6F12O |
|---|---|
| Molecular Weight | 316.04400 |
| Exact Mass | 315.97600 |
| PSA | 17.07000 |
| LogP | 3.79110 |
| InChIKey | VQOUZQMAWUSCKR-UHFFFAOYSA-N |
| SMILES | O=C(C(F)(F)F)C(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
|
~23%
1,1,1,4,4,4-hex... CAS#:88995-83-9 |
| Literature: Adcock, James L.; Robin, Mark L. Journal of Organic Chemistry, 1984 , vol. 49, # 8 p. 1442 - 1445 |
|
~%
1,1,1,4,4,4-hex... CAS#:88995-83-9 |
| Literature: Jackson, Richard A; Townson, Michael Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1980 , p. 1452 - 1456 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Butanone,1,1,1,4,4,4-hexafluoro-3,3-bis(trifluoromethyl) |
| F-3,3-Dimethyl-2-butanone |