Carbonic acid, 2-bromoethyl pentachlorophenyl ester structure
|
Common Name | Carbonic acid, 2-bromoethyl pentachlorophenyl ester | ||
|---|---|---|---|---|
| CAS Number | 890-27-7 | Molecular Weight | 417.29500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H4BrCl5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-bromoethyl (2,3,4,5,6-pentachlorophenyl) carbonate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H4BrCl5O3 |
|---|---|
| Molecular Weight | 417.29500 |
| Exact Mass | 413.77900 |
| PSA | 35.53000 |
| LogP | 5.86390 |
| InChIKey | VJSCFCUJUPGXMG-UHFFFAOYSA-N |
| SMILES | O=C(OCCBr)Oc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| HS Code | 2920909090 |
|---|
|
~%
Carbonic acid, ... CAS#:890-27-7 |
| Literature: Ismail,R.M.; Buening,R. Journal fuer Praktische Chemie (Leipzig), 1969 , vol. 311, p. 656 - 660 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Phenol,pentachloro-,2-bromoethylcarbonate (8CI) |
| Ethanol,2-bromo-,pentachlorophenyl carbonate (8CI) |
| Pentachlorphenyl-(2-brom-ethyl)-carbonat |
| Carbonic acid,2-bromoethyl pentachlorophenyl ester (7CI,8CI) |
| (2-Bromethyl)-pentachlorphenyl-carbonat |