3-methylsulfanyl-1,3-diphenylprop-2-en-1-one structure
|
Common Name | 3-methylsulfanyl-1,3-diphenylprop-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 89003-28-1 | Molecular Weight | 254.34700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-methylsulfanyl-1,3-diphenylprop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H14OS |
|---|---|
| Molecular Weight | 254.34700 |
| Exact Mass | 254.07700 |
| PSA | 42.37000 |
| LogP | 4.27340 |
| InChIKey | VXQYLHRQSRQQBC-UHFFFAOYSA-N |
| SMILES | CSC(=CC(=O)c1ccccc1)c1ccccc1 |
|
~9%
3-methylsulfany... CAS#:89003-28-1 |
| Literature: Apparao, Satyam; Ila, Hiriyakkanavar; Junjappa, Hirijakkanavar Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 12 p. 2837 - 2844 |
|
~10%
3-methylsulfany... CAS#:89003-28-1 |
| Literature: Apparao, Satyam; Ila, Hiriyakkanavar; Junjappa, Hirijakkanavar Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 12 p. 2837 - 2844 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 2-Propen-1-one,3-(methylthio)-1,3-diphenyl-,(Z) |