1-(dimethylaminomethyl)-3-phenyl-pyrrolidine-2,5-dione structure
|
Common Name | 1-(dimethylaminomethyl)-3-phenyl-pyrrolidine-2,5-dione | ||
|---|---|---|---|---|
| CAS Number | 89003-32-7 | Molecular Weight | 232.27800 | |
| Density | 1.171g/cm3 | Boiling Point | 404.1ºC at 760 mmHg | |
| Molecular Formula | C13H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185ºC | |
| Name | 1-[(dimethylamino)methyl]-3-phenylpyrrolidine-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.171g/cm3 |
|---|---|
| Boiling Point | 404.1ºC at 760 mmHg |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.27800 |
| Flash Point | 185ºC |
| Exact Mass | 232.12100 |
| PSA | 40.62000 |
| LogP | 0.98610 |
| Index of Refraction | 1.562 |
| InChIKey | SPHBSPQGKZIDTK-UHFFFAOYSA-N |
| SMILES | CN(C)CN1C(=O)CC(c2ccccc2)C1=O |
|
~66%
1-(dimethylamin... CAS#:89003-32-7 |
| Literature: Coyle, John D.; Bryant, Laurence, R. B. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 12 p. 2857 - 2865 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N-(dimethylaminomethyl)-2-phenylsuccinimide |
| 1-(dimethylaminomethyl)-3-phenylpyrrolidine-2,5-dione |