2-[(4,5-diphenyl-1,3-oxazol-2-yl)methyl]cyclohexan-1-one
Modify Date: 2026-07-16 18:45:12
![2-[(4,5-diphenyl-1,3-oxazol-2-yl)methyl]cyclohexan-1-one Structure](https://image.chemsrc.com/caspic/340/89004-10-4.png)
2-[(4,5-diphenyl-1,3-oxazol-2-yl)methyl]cyclohexan-1-one structure
|
Common Name | 2-[(4,5-diphenyl-1,3-oxazol-2-yl)methyl]cyclohexan-1-one | ||
|---|---|---|---|---|
| CAS Number | 89004-10-4 | Molecular Weight | 331.40800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H21NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[(4,5-diphenyl-1,3-oxazol-2-yl)methyl]cyclohexan-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H21NO2 |
|---|---|
| Molecular Weight | 331.40800 |
| Exact Mass | 331.15700 |
| PSA | 43.10000 |
| LogP | 5.31040 |
| InChIKey | MEQJPXYKIAFQHB-UHFFFAOYSA-N |
| SMILES | O=C1CCCCC1Cc1nc(-c2ccccc2)c(-c2ccccc2)o1 |
|
~%
2-[(4,5-dipheny... CAS#:89004-10-4 |
| Literature: Sasaki, Tadashi; Ito, Eikoh; Asai, Koji Heterocycles, 1984 , vol. 21, # 2 p. 373 |
|
~%
2-[(4,5-dipheny... CAS#:89004-10-4 |
| Literature: Sasaki, Tadashi; Ohno, Masatomi; Ito, Eikoh Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 12 p. 3027 - 3030 |
![2,3-diphenyl-6,7,8,9,9a,10-hexahydroimidazo[1,2-b]cinnoline structure](https://image.chemsrc.com/caspic/264/89004-12-6.png)
CAS#:89004-12-6![2,3-diphenyl-5,5a,6,7,8,9,9a,10-octahydroimidazo[1,2-b]cinnoline structure](https://image.chemsrc.com/caspic/188/89004-14-8.png)
CAS#:89004-14-8| 2-[(4,5-diphenyl-oxazol-2-yl)methyl]cyclohexanone |
| 2-(2-oxocyclohexyl)-4,5-diphenyloxazole |
| Cyclohexanone,2-[(4,5-diphenyl-2-oxazolyl)methyl] |