trimethyl(4-triphenylsilylbut-2-enyl)silane
trimethyl(4-triphenylsilylbut-2-enyl)silane structure
|
Common Name | trimethyl(4-triphenylsilylbut-2-enyl)silane | ||
|---|---|---|---|---|
| CAS Number | 89006-33-7 | Molecular Weight | 386.67700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H30Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: Trimethyl(4-triphenylsilylbut-2-enyl)silane, Chinese name: 三甲基(4-三苯基甲硅烷基丁-2-烯)甲硅烷, CAS number: 89006-33-7, Molecular formula: C25H30Si2, Molecular weight: 386.67700. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | trimethyl(4-triphenylsilylbut-2-enyl)silane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C25H30Si2 |
|---|---|
| Molecular Weight | 386.67700 |
| Exact Mass | 386.18900 |
| LogP | 5.05120 |
| InChIKey | PHRHYCQKWMXDNT-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)CC=CC[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~56%
trimethyl(4-tri... CAS#:89006-33-7 |
| Literature: Hiyama, Tamejiro; Obayashi, Michio; Mori, Ichiro; Nozaki, Hitosi Journal of Organic Chemistry, 1983 , vol. 48, # 6 p. 912 - 914 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Silane,trimethyl[4-(triphenylsilyl)-2-butenyl] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of trimethyl(4-triphenylsilylbut-2-enyl)silane? |
| A: CAS number of trimethyl(4-triphenylsilylbut-2-enyl)silane is 89006-33-7. |
| Q: What is the molecular weight of trimethyl(4-triphenylsilylbut-2-enyl)silane? |
| A: Molecular weight of trimethyl(4-triphenylsilylbut-2-enyl)silane is 386.67700. |
| Q: What English synonyms does trimethyl(4-triphenylsilylbut-2-enyl)silane have? |
| A: English synonyms of trimethyl(4-triphenylsilylbut-2-enyl)silane: Silane,trimethyl[4-(triphenylsilyl)-2-butenyl]. |
| Q: What are the upstream materials of trimethyl(4-triphenylsilylbut-2-enyl)silane? |
| A: Related upstream materials(CAS) of trimethyl(4-triphenylsilylbut-2-enyl)silane: 1450-18-6;106-99-0. |
| Q: What is the Chinese name of 89006-33-7? |
| A: Chinese name of 89006-33-7 is 89006-33-7. |
| Q: What is the English name of trimethyl(4-triphenylsilylbut-2-enyl)silane? |
| A: The English name of trimethyl(4-triphenylsilylbut-2-enyl)silane is trimethyl(4-triphenylsilylbut-2-enyl)silane. |
| Q: What is the InChIKey of trimethyl(4-triphenylsilylbut-2-enyl)silane? |
| A: InChIKey of trimethyl(4-triphenylsilylbut-2-enyl)silane is PHRHYCQKWMXDNT-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of trimethyl(4-triphenylsilylbut-2-enyl)silane? |
| A: SMILES notation of trimethyl(4-triphenylsilylbut-2-enyl)silane is C[Si](C)(C)CC=CC[Si](c1ccccc1)(c1ccccc1)c1ccccc1. |
| Q: What is the molecular formula of trimethyl(4-triphenylsilylbut-2-enyl)silane? |
| A: Molecular formula of trimethyl(4-triphenylsilylbut-2-enyl)silane is C25H30Si2. |
| Q: What is the LogP of trimethyl(4-triphenylsilylbut-2-enyl)silane? |
| A: LogP of trimethyl(4-triphenylsilylbut-2-enyl)silane is 5.05120. |