5-nitro-2-[2-(5-nitro-1,3-dioxoisoindol-2-yl)ethyl]isoindole-1,3-dione structure
|
Common Name | 5-nitro-2-[2-(5-nitro-1,3-dioxoisoindol-2-yl)ethyl]isoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 89024-42-0 | Molecular Weight | 410.29400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H10N4O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-nitro-2-[2-(5-nitro-1,3-dioxoisoindol-2-yl)ethyl]isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H10N4O8 |
|---|---|
| Molecular Weight | 410.29400 |
| Exact Mass | 410.05000 |
| PSA | 166.40000 |
| LogP | 2.31740 |
| InChIKey | GCSGEQLDPXQLHP-UHFFFAOYSA-N |
| SMILES | O=C1c2ccc([N+](=O)[O-])cc2C(=O)N1CCN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O |
|
~%
5-nitro-2-[2-(5... CAS#:89024-42-0 |
| Literature: Billman; Cash Journal of the American Chemical Society, 1954 , vol. 76, p. 1944 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1H-Isoindole-1,3(2H)-dione,2,2'-(1,2-ethanediyl)bis[5-nitro |
| 5,5'-Dinitro-2,2'-aethandiyl-bis-isoindolin-1,3-dion |
| 5,5'-dinitro-2,2'-ethanediyl-bis-isoindoline-1,3-dione |