2,6-dimethylidenebicyclo[3.1.0]hexan-4-ol,methanesulfonic acid structure
|
Common Name | 2,6-dimethylidenebicyclo[3.1.0]hexan-4-ol,methanesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 89032-33-7 | Molecular Weight | 218.27000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H14O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,6-dimethylidenebicyclo[3.1.0]hexan-4-ol,methanesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H14O4S |
|---|---|
| Molecular Weight | 218.27000 |
| Exact Mass | 218.06100 |
| PSA | 82.98000 |
| LogP | 1.69420 |
| InChIKey | ZFZPHJJWOBLRGH-UHFFFAOYSA-N |
| SMILES | C=C1CC(O)C2C(=C)C12.CS(=O)(=O)O |
|
~%
2,6-dimethylide... CAS#:89032-33-7 |
| Literature: Goodman, Joshua L.; Berson, Jerome A. Journal of the American Chemical Society, 1984 , vol. 106, # 6 p. 1867 - 1868 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Bicyclo[3.1.0]hexan-2-ol,4,6-bis(methylene)-,methanesulfonate |