2-(3-fluorophenyl)-3H-imidazo[4,5-c]pyridine
Modify Date: 2025-09-13 16:08:26
![2-(3-fluorophenyl)-3H-imidazo[4,5-c]pyridine Structure](https://image.chemsrc.com/caspic/185/89074-94-2.png)
2-(3-fluorophenyl)-3H-imidazo[4,5-c]pyridine structure
|
Common Name | 2-(3-fluorophenyl)-3H-imidazo[4,5-c]pyridine | ||
|---|---|---|---|---|
| CAS Number | 89074-94-2 | Molecular Weight | 213.21000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8FN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(3-fluorophenyl)-3H-imidazo[4,5-c]pyridine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H8FN3 |
|---|---|
| Molecular Weight | 213.21000 |
| Exact Mass | 213.07000 |
| PSA | 41.57000 |
| LogP | 2.76400 |
| InChIKey | UHOZQNLICXTVNV-UHFFFAOYSA-N |
| SMILES | Fc1cccc(-c2nc3ccncc3[nH]2)c1 |
|
~%
2-(3-fluorophen... CAS#:89074-94-2 |
| Literature: Robertson; Beedle; Krushinski; Pollock; Wilson; Wyss; Hayes Journal of Medicinal Chemistry, 1985 , vol. 28, # 6 p. 717 - 727 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: Compound tested for contractility in anesthetized dog when administered intravenously...
Source: ChEMBL
Target: Canis lupus familiaris
External Id: CHEMBL883878
|
|
Name: Compound tested for contractility in isolated cat papillary muscle at 10 e-4 M.
Source: ChEMBL
Target: Felis catus
External Id: CHEMBL657181
|
|
Name: Response ratio = (percent increase to drug)/(percent increase to 10 E-4 M isoproteren...
Source: ChEMBL
Target: Felis catus
External Id: CHEMBL657663
|
|
Name: Compound tested for contractility in isolated cat papillary muscle at 10 e-5 M.
Source: ChEMBL
Target: Felis catus
External Id: CHEMBL657183
|
|
Name: Response ratio = (percent increase to drug)/(percent increase to 10 E-5 M isoproteren...
Source: ChEMBL
Target: Felis catus
External Id: CHEMBL657664
|
Total 5, Current Page 1 of 1
1
| 1H-Imidazo[4,5-c]pyridine,2-(3-fluorophenyl) |
| 2-(3-fluorophenyl)-3H-imidazo[5,4-c]pyridine |
| 2-(3-fluorophenyl)imidazo[4,5-c]pyridine |