1-(2,2-dimethyl-6-nitrochromen-4-yl)pyrrolidin-2-one structure
|
Common Name | 1-(2,2-dimethyl-6-nitrochromen-4-yl)pyrrolidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 89080-73-9 | Molecular Weight | 288.29900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2,2-dimethyl-6-nitrochromen-4-yl)pyrrolidin-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H16N2O4 |
|---|---|
| Molecular Weight | 288.29900 |
| Exact Mass | 288.11100 |
| PSA | 75.36000 |
| LogP | 3.19020 |
| InChIKey | JAKUAEJZCYSRHN-UHFFFAOYSA-N |
| SMILES | CC1(C)C=C(N2CCCC2=O)c2cc([N+](=O)[O-])ccc2O1 |
|
~5%
1-(2,2-dimethyl... CAS#:89080-73-9 |
| Literature: Ashwood; Buckingham; Cassidy; Evans; Faruk; Hamilton; Nash; Stemp; Willcocks Journal of Medicinal Chemistry, 1986 , vol. 29, # 11 p. 2194 - 2201 |
|
~%
1-(2,2-dimethyl... CAS#:89080-73-9 |
| Literature: Ashwood; Buckingham; Cassidy; Evans; Faruk; Hamilton; Nash; Stemp; Willcocks Journal of Medicinal Chemistry, 1986 , vol. 29, # 11 p. 2194 - 2201 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Pyrrolidinone,1-(2,2-dimethyl-6-nitro-2H-1-benzopyran-4-yl) |
| 2,2-dimethyl-6-nitro-4-(2-oxo-1-pyrrolidinyl)-2H-1-benzopyran |