1-cyclohexyl-2-diphenylphosphorylpropan-1-one structure
|
Common Name | 1-cyclohexyl-2-diphenylphosphorylpropan-1-one | ||
|---|---|---|---|---|
| CAS Number | 89091-87-2 | Molecular Weight | 340.39600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H25O2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-cyclohexyl-2-diphenylphosphorylpropan-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H25O2P |
|---|---|
| Molecular Weight | 340.39600 |
| Exact Mass | 340.15900 |
| PSA | 43.95000 |
| LogP | 4.53840 |
| InChIKey | LARXGAVQLOOTKY-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1CCCCC1)P(=O)(c1ccccc1)c1ccccc1 |
|
~88%
1-cyclohexyl-2-... CAS#:89091-87-2 |
| Literature: Bartoli, Giuseppe; Bosco, Marcella; Dalpozzo, Renato; Marcantoni, Enrico; Sambri, Letizia Chemistry - A European Journal, 1997 , vol. 3, # 12 p. 1941 - 1950 |
|
~%
1-cyclohexyl-2-... CAS#:89091-87-2 |
| Literature: Buss, Antony D.; Warren, Stuart Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1985 , p. 2307 - 2326 |
|
~%
1-cyclohexyl-2-... CAS#:89091-87-2 |
| Literature: Buss, Antony D.; Warren, Stuart Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1985 , p. 2307 - 2326 |
| 1-cyclohexyl-2-diphenylphosphinoylpropan-1-one |
| 1-Propanone,1-cyclohexyl-2-(diphenylphosphinyl) |