3,10-dimethoxybenzo[b]xanthene-6,11,12-trione structure
|
Common Name | 3,10-dimethoxybenzo[b]xanthene-6,11,12-trione | ||
|---|---|---|---|---|
| CAS Number | 89148-83-4 | Molecular Weight | 336.29500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H12O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,10-dimethoxybenzo[b]xanthene-6,11,12-trione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H12O6 |
|---|---|
| Molecular Weight | 336.29500 |
| Exact Mass | 336.06300 |
| PSA | 82.81000 |
| LogP | 2.58560 |
| InChIKey | DMDKIUBXILMELL-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(=O)c3c(oc2c1)C(=O)c1cccc(OC)c1C3=O |
|
~90%
3,10-dimethoxyb... CAS#:89148-83-4 |
| Literature: Kjaer, Dana; Kjaer, Anders; Risbjerg, Elisabeth Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 11 p. 2815 - 2820 |
|
~%
3,10-dimethoxyb... CAS#:89148-83-4 |
| Literature: Kjaer, Dana; Kjaer, Anders; Risbjerg, Elisabeth Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 11 p. 2815 - 2820 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 11H-Benzo[b]xanthene-6,11,12-trione,3,10-dimethoxy |
| 6,12-dihydro-3,10-dimethoxy-11H-benzo[b]xanthene-6,11,12-trione |