methyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate
![methyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate Structure](https://image.chemsrc.com/caspic/160/89159-83-1.png)
methyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate structure
|
Common Name | methyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 89159-83-1 | Molecular Weight | 232.27800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H16N2O2 |
|---|---|
| Molecular Weight | 232.27800 |
| Exact Mass | 232.12100 |
| PSA | 57.61000 |
| LogP | 2.65930 |
| InChIKey | FZXXTZQPPDGKAH-UHFFFAOYSA-N |
| SMILES | COC(=O)NC(C)Cc1c[nH]c2ccccc12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~91%
methyl N-[1-(1H... CAS#:89159-83-1 |
| Literature: Dolicheva, I. N.; Smushkevich, Yu. I.; Suvorov, N. N.; Gridneva, L. I.; Gorkin, V. Z.; et al. Pharmaceutical Chemistry Journal, 1983 , vol. 17, # 9 p. 603 - 607 Khimiko-Farmatsevticheskii Zhurnal, 1983 , vol. 17, # 9 p. 1033 - 1037 |
|
~%
methyl N-[1-(1H... CAS#:89159-83-1 |
| Literature: Crich, David; Chan, Chat-on; Davies, John W.; Natarajan, Swaminathan; Vinter, Jeremy G. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1992 , # 12 p. 2233 - 2240 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 1 | |
CAS#:86995-94-0This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (+/-)-1-(3-indolyl)-2-methoxycarbamoylpropane |
| Carbamic acid,[2-(1H-indol-3-yl)-1-methylethyl]-,methyl ester |
| 1-Indolyl-3-isopropylcarbomethoxyamine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of methyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate? |
| A: InChIKey of methyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate is FZXXTZQPPDGKAH-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of methyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate? |
| A: Polar surface area (PSA) of methyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate is 57.61000. |
| Q: What is the LogP of methyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate? |
| A: LogP of methyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate is 2.65930. |
| Q: What English synonyms does methyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate have? |
| A: English synonyms of methyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate: (+/-)-1-(3-indolyl)-2-methoxycarbamoylpropane, Carbamic acid,[2-(1H-indol-3-yl)-1-methylethyl]-,methyl ester, 1-Indolyl-3-isopropylcarbomethoxyamine. |
| Q: What is the molecular formula of methyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate? |
| A: Molecular formula of methyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate is C13H16N2O2. |
| Q: What is the Chinese name of 89159-83-1? |
| A: Chinese name of 89159-83-1 is 89159-83-1. |
| Q: What is the SMILES notation of methyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate? |
| A: SMILES notation of methyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate is COC(=O)NC(C)Cc1c[nH]c2ccccc12. |
| Q: What is the molecular weight of methyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate? |
| A: Molecular weight of methyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate is 232.27800. |
| Q: What are the downstream products of methyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate? |
| A: Related downstream products(CAS) of methyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate: 86995-94-0. |
| Q: What is the English name of methyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate? |
| A: The English name of methyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate is methyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate. |