8-[[methyl(prop-2-ynyl)amino]methyl]quinoline-5-carbonitrile
![8-[[methyl(prop-2-ynyl)amino]methyl]quinoline-5-carbonitrile Structure](https://image.chemsrc.com/caspic/432/89159-89-7.png)
8-[[methyl(prop-2-ynyl)amino]methyl]quinoline-5-carbonitrile structure
|
Common Name | 8-[[methyl(prop-2-ynyl)amino]methyl]quinoline-5-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 89159-89-7 | Molecular Weight | 235.28400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H13N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 8-[[methyl(prop-2-ynyl)amino]methyl]quinoline-5-carbonitrile |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H13N3 |
|---|---|
| Molecular Weight | 235.28400 |
| Exact Mass | 235.11100 |
| PSA | 39.92000 |
| LogP | 2.17148 |
| InChIKey | RARIYIHUQUPUSY-UHFFFAOYSA-N |
| SMILES | C#CCN(C)Cc1ccc(C#N)c2cccnc12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 1 | |
![8-[[methyl(prop-2-ynyl)amino]methyl]quinoline-5-carboxamide structure](https://image.chemsrc.com/caspic/453/89159-93-3.png)
CAS#:89159-93-3This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5-Quinolinecarbonitrile,8-[(methyl-2-propynylamino)methyl] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 8-[[methyl(prop-2-ynyl)amino]methyl]quinoline-5-carbonitrile have? |
| A: English synonyms of 8-[[methyl(prop-2-ynyl)amino]methyl]quinoline-5-carbonitrile: 5-Quinolinecarbonitrile,8-[(methyl-2-propynylamino)methyl]. |
| Q: What are the downstream products of 8-[[methyl(prop-2-ynyl)amino]methyl]quinoline-5-carbonitrile? |
| A: Related downstream products(CAS) of 8-[[methyl(prop-2-ynyl)amino]methyl]quinoline-5-carbonitrile: 89159-93-3. |
| Q: What is the molecular formula of 8-[[methyl(prop-2-ynyl)amino]methyl]quinoline-5-carbonitrile? |
| A: Molecular formula of 8-[[methyl(prop-2-ynyl)amino]methyl]quinoline-5-carbonitrile is C15H13N3. |
| Q: What is the InChIKey of 8-[[methyl(prop-2-ynyl)amino]methyl]quinoline-5-carbonitrile? |
| A: InChIKey of 8-[[methyl(prop-2-ynyl)amino]methyl]quinoline-5-carbonitrile is RARIYIHUQUPUSY-UHFFFAOYSA-N. |
| Q: What is the English name of 8-[[methyl(prop-2-ynyl)amino]methyl]quinoline-5-carbonitrile? |
| A: The English name of 8-[[methyl(prop-2-ynyl)amino]methyl]quinoline-5-carbonitrile is 8-[[methyl(prop-2-ynyl)amino]methyl]quinoline-5-carbonitrile. |
| Q: What is the SMILES notation of 8-[[methyl(prop-2-ynyl)amino]methyl]quinoline-5-carbonitrile? |
| A: SMILES notation of 8-[[methyl(prop-2-ynyl)amino]methyl]quinoline-5-carbonitrile is C#CCN(C)Cc1ccc(C#N)c2cccnc12. |
| Q: What is the polar surface area (PSA) of 8-[[methyl(prop-2-ynyl)amino]methyl]quinoline-5-carbonitrile? |
| A: Polar surface area (PSA) of 8-[[methyl(prop-2-ynyl)amino]methyl]quinoline-5-carbonitrile is 39.92000. |
| Q: What is the molecular weight of 8-[[methyl(prop-2-ynyl)amino]methyl]quinoline-5-carbonitrile? |
| A: Molecular weight of 8-[[methyl(prop-2-ynyl)amino]methyl]quinoline-5-carbonitrile is 235.28400. |
| Q: What are the upstream materials of 8-[[methyl(prop-2-ynyl)amino]methyl]quinoline-5-carbonitrile? |
| A: Related upstream materials(CAS) of 8-[[methyl(prop-2-ynyl)amino]methyl]quinoline-5-carbonitrile: 35161-71-8;74316-59-9. |
| Q: What is the Chinese name of 89159-89-7? |
| A: Chinese name of 89159-89-7 is 89159-89-7. |