1-methyl-4-[2-[[2-(4-methylphenyl)sulfonyl-1-phenylethyl]diselanyl]-2-phenylethyl]sulfonylbenzene structure
|
Common Name | 1-methyl-4-[2-[[2-(4-methylphenyl)sulfonyl-1-phenylethyl]diselanyl]-2-phenylethyl]sulfonylbenzene | ||
|---|---|---|---|---|
| CAS Number | 89165-57-1 | Molecular Weight | 676.60700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H30O4S2Se2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-methyl-4-[2-[[2-(4-methylphenyl)sulfonyl-1-phenylethyl]diselanyl]-2-phenylethyl]sulfonylbenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C30H30O4S2Se2 |
|---|---|
| Molecular Weight | 676.60700 |
| Exact Mass | 677.99200 |
| PSA | 85.04000 |
| LogP | 7.70960 |
| InChIKey | BDHLEXZDORLZGU-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)CC([Se][Se]C(CS(=O)(=O)c2ccc(C)cc2)c2ccccc2)c2ccccc2)cc1 |
|
~%
1-methyl-4-[2-[... CAS#:89165-57-1 |
| Literature: Kang, Young-Hee; Kice, John L. Journal of Organic Chemistry, 1984 , vol. 49, # 9 p. 1507 - 1511 |
|
~%
1-methyl-4-[2-[... CAS#:89165-57-1 |
| Literature: Kang, Young-Hee; Kice, John L. Journal of Organic Chemistry, 1984 , vol. 49, # 9 p. 1507 - 1511 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Diselenide,bis[2-[(4-methylphenyl)sulfonyl]-1-phenylethyl] |
| bis(2-(p-tolylsulfonyl)-1-phenylethyl)diselenide |