2-(4,6-diphenylpyridin-2-yl)-2-prop-1-enylpropanedinitrile
2-(4,6-diphenylpyridin-2-yl)-2-prop-1-enylpropanedinitrile structure
|
Common Name | 2-(4,6-diphenylpyridin-2-yl)-2-prop-1-enylpropanedinitrile | ||
|---|---|---|---|---|
| CAS Number | 89174-49-2 | Molecular Weight | 335.40100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H17N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(4,6-diphenylpyridin-2-yl)-2-prop-1-enylpropanedinitrile |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C23H17N3 |
|---|---|
| Molecular Weight | 335.40100 |
| Exact Mass | 335.14200 |
| PSA | 60.47000 |
| LogP | 5.27666 |
| InChIKey | JUVKJLYMXXNIRB-UHFFFAOYSA-N |
| SMILES | CC=CC(C#N)(C#N)c1cc(-c2ccccc2)cc(-c2ccccc2)n1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2-(4,6-diphenyl... CAS#:89174-49-2 |
| Literature: Molina, P.; Lorenzo, A. Tetrahedron Letters, 1983 , vol. 24, # 51 p. 5805 - 5806 |
|
~%
2-(4,6-diphenyl... CAS#:89174-49-2 |
| Literature: Molina, P.; Lorenzo, A. Tetrahedron Letters, 1983 , vol. 24, # 51 p. 5805 - 5806 |
|
~%
2-(4,6-diphenyl... CAS#:89174-49-2 |
| Literature: Molina, P.; Lorenzo, A. Tetrahedron Letters, 1983 , vol. 24, # 51 p. 5805 - 5806 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Propanedinitrile,(4,6-diphenyl-2-pyridinyl)-2-propenyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-(4,6-diphenylpyridin-2-yl)-2-prop-1-enylpropanedinitrile? |
| A: CAS number of 2-(4,6-diphenylpyridin-2-yl)-2-prop-1-enylpropanedinitrile is 89174-49-2. |
| Q: What is the molecular weight of 2-(4,6-diphenylpyridin-2-yl)-2-prop-1-enylpropanedinitrile? |
| A: Molecular weight of 2-(4,6-diphenylpyridin-2-yl)-2-prop-1-enylpropanedinitrile is 335.40100. |
| Q: What is the molecular formula of 2-(4,6-diphenylpyridin-2-yl)-2-prop-1-enylpropanedinitrile? |
| A: Molecular formula of 2-(4,6-diphenylpyridin-2-yl)-2-prop-1-enylpropanedinitrile is C23H17N3. |
| Q: What is the English name of 2-(4,6-diphenylpyridin-2-yl)-2-prop-1-enylpropanedinitrile? |
| A: The English name of 2-(4,6-diphenylpyridin-2-yl)-2-prop-1-enylpropanedinitrile is 2-(4,6-diphenylpyridin-2-yl)-2-prop-1-enylpropanedinitrile. |
| Q: What is the InChIKey of 2-(4,6-diphenylpyridin-2-yl)-2-prop-1-enylpropanedinitrile? |
| A: InChIKey of 2-(4,6-diphenylpyridin-2-yl)-2-prop-1-enylpropanedinitrile is JUVKJLYMXXNIRB-UHFFFAOYSA-N. |
| Q: What English synonyms does 2-(4,6-diphenylpyridin-2-yl)-2-prop-1-enylpropanedinitrile have? |
| A: English synonyms of 2-(4,6-diphenylpyridin-2-yl)-2-prop-1-enylpropanedinitrile: Propanedinitrile,(4,6-diphenyl-2-pyridinyl)-2-propenyl. |
| Q: What is the SMILES notation of 2-(4,6-diphenylpyridin-2-yl)-2-prop-1-enylpropanedinitrile? |
| A: SMILES notation of 2-(4,6-diphenylpyridin-2-yl)-2-prop-1-enylpropanedinitrile is CC=CC(C#N)(C#N)c1cc(-c2ccccc2)cc(-c2ccccc2)n1. |
| Q: What is the polar surface area (PSA) of 2-(4,6-diphenylpyridin-2-yl)-2-prop-1-enylpropanedinitrile? |
| A: Polar surface area (PSA) of 2-(4,6-diphenylpyridin-2-yl)-2-prop-1-enylpropanedinitrile is 60.47000. |
| Q: What are the upstream materials of 2-(4,6-diphenylpyridin-2-yl)-2-prop-1-enylpropanedinitrile? |
| A: Related upstream materials(CAS) of 2-(4,6-diphenylpyridin-2-yl)-2-prop-1-enylpropanedinitrile: 26479-00-5;83318-98-3;89174-43-6. |
| Q: What is the LogP of 2-(4,6-diphenylpyridin-2-yl)-2-prop-1-enylpropanedinitrile? |
| A: LogP of 2-(4,6-diphenylpyridin-2-yl)-2-prop-1-enylpropanedinitrile is 5.27666. |