2-[6-(3,4-Dimethoxyphenyl)imidazo[2,1-b]thiazol-3-yl]acetic Acid
Modify Date: 2025-11-07 06:40:53
![2-[6-(3,4-Dimethoxyphenyl)imidazo[2,1-b]thiazol-3-yl]acetic Acid Structure](https://www.chemsrc.com/extcaspic/030/891753-65-4.png)
2-[6-(3,4-Dimethoxyphenyl)imidazo[2,1-b]thiazol-3-yl]acetic Acid structure
|
Common Name | 2-[6-(3,4-Dimethoxyphenyl)imidazo[2,1-b]thiazol-3-yl]acetic Acid | ||
|---|---|---|---|---|
| CAS Number | 891753-65-4 | Molecular Weight | 318.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[6-(3,4-Dimethoxyphenyl)imidazo[2,1-b]thiazol-3-yl]acetic Acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H14N2O4S |
|---|---|
| Molecular Weight | 318.3 |
| InChIKey | KMGIKWVWCRMJKZ-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2cn3c(CC(=O)O)csc3n2)cc1OC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-[6-(3,4-Dimethoxyphenyl)imidazo[2,1-b]thiazol-3-yl]acetic Acid? |
| A: CAS number of 2-[6-(3,4-Dimethoxyphenyl)imidazo[2,1-b]thiazol-3-yl]acetic Acid is 891753-65-4. |
| Q: What is the molecular formula of 2-[6-(3,4-Dimethoxyphenyl)imidazo[2,1-b]thiazol-3-yl]acetic Acid? |
| A: Molecular formula of 2-[6-(3,4-Dimethoxyphenyl)imidazo[2,1-b]thiazol-3-yl]acetic Acid is C15H14N2O4S. |
| Q: What is the Chinese name of 891753-65-4? |
| A: Chinese name of 891753-65-4 is 891753-65-4. |
| Q: What is the SMILES notation of 2-[6-(3,4-Dimethoxyphenyl)imidazo[2,1-b]thiazol-3-yl]acetic Acid? |
| A: SMILES notation of 2-[6-(3,4-Dimethoxyphenyl)imidazo[2,1-b]thiazol-3-yl]acetic Acid is COc1ccc(-c2cn3c(CC(=O)O)csc3n2)cc1OC. |
| Q: What is the molecular weight of 2-[6-(3,4-Dimethoxyphenyl)imidazo[2,1-b]thiazol-3-yl]acetic Acid? |
| A: Molecular weight of 2-[6-(3,4-Dimethoxyphenyl)imidazo[2,1-b]thiazol-3-yl]acetic Acid is 318.3. |
| Q: What is the English name of 2-[6-(3,4-Dimethoxyphenyl)imidazo[2,1-b]thiazol-3-yl]acetic Acid? |
| A: The English name of 2-[6-(3,4-Dimethoxyphenyl)imidazo[2,1-b]thiazol-3-yl]acetic Acid is 2-[6-(3,4-Dimethoxyphenyl)imidazo[2,1-b]thiazol-3-yl]acetic Acid. |
| Q: What is the InChIKey of 2-[6-(3,4-Dimethoxyphenyl)imidazo[2,1-b]thiazol-3-yl]acetic Acid? |
| A: InChIKey of 2-[6-(3,4-Dimethoxyphenyl)imidazo[2,1-b]thiazol-3-yl]acetic Acid is KMGIKWVWCRMJKZ-UHFFFAOYSA-N. |