1,1,1,2,2-pentafluorooct-4-en-3-one
1,1,1,2,2-pentafluorooct-4-en-3-one structure
|
Common Name | 1,1,1,2,2-pentafluorooct-4-en-3-one | ||
|---|---|---|---|---|
| CAS Number | 89176-01-2 | Molecular Weight | 216.14800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H9F5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 1,1,1,2,2-Pentafluorooct-4-en-3-one, CAS 89176-01-2, molecular formula C8H9F5O, molecular weight 216.14800. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,1,1,2,2-pentafluorooct-4-en-3-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H9F5O |
|---|---|
| Molecular Weight | 216.14800 |
| Exact Mass | 216.05700 |
| PSA | 17.07000 |
| LogP | 3.10940 |
| InChIKey | LPABANPYVUTJPA-UHFFFAOYSA-N |
| SMILES | CCCC=CC(=O)C(F)(F)C(F)(F)F |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1,1,1,2,2-penta... CAS#:89176-01-2 |
| Literature: Ishihara, Takashi; Maekawa, Takashige; Ando, Teiichi Tetrahedron Letters, 1983 , vol. 24, # 39 p. 4229 - 4232 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-Octen-3-one,1,1,1,2,2-pentafluoro-,(E) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of 1,1,1,2,2-pentafluorooct-4-en-3-one? |
| A: Related upstream materials(CAS) of 1,1,1,2,2-pentafluorooct-4-en-3-one: 123-72-8. |
| Q: What is the CAS number of 1,1,1,2,2-pentafluorooct-4-en-3-one? |
| A: CAS number of 1,1,1,2,2-pentafluorooct-4-en-3-one is 89176-01-2. |
| Q: What is the molecular weight of 1,1,1,2,2-pentafluorooct-4-en-3-one? |
| A: Molecular weight of 1,1,1,2,2-pentafluorooct-4-en-3-one is 216.14800. |
| Q: What is the LogP of 1,1,1,2,2-pentafluorooct-4-en-3-one? |
| A: LogP of 1,1,1,2,2-pentafluorooct-4-en-3-one is 3.10940. |
| Q: What is the English name of 1,1,1,2,2-pentafluorooct-4-en-3-one? |
| A: The English name of 1,1,1,2,2-pentafluorooct-4-en-3-one is 1,1,1,2,2-pentafluorooct-4-en-3-one. |
| Q: What is the Chinese name of 89176-01-2? |
| A: Chinese name of 89176-01-2 is 89176-01-2. |
| Q: What is the molecular formula of 1,1,1,2,2-pentafluorooct-4-en-3-one? |
| A: Molecular formula of 1,1,1,2,2-pentafluorooct-4-en-3-one is C8H9F5O. |
| Q: What is the InChIKey of 1,1,1,2,2-pentafluorooct-4-en-3-one? |
| A: InChIKey of 1,1,1,2,2-pentafluorooct-4-en-3-one is LPABANPYVUTJPA-UHFFFAOYSA-N. |
| Q: What English synonyms does 1,1,1,2,2-pentafluorooct-4-en-3-one have? |
| A: English synonyms of 1,1,1,2,2-pentafluorooct-4-en-3-one: 4-Octen-3-one,1,1,1,2,2-pentafluoro-,(E). |
| Q: What is the polar surface area (PSA) of 1,1,1,2,2-pentafluorooct-4-en-3-one? |
| A: Polar surface area (PSA) of 1,1,1,2,2-pentafluorooct-4-en-3-one is 17.07000. |