7-Methyl-2-phenylimidazo[1,2-a]pyridin-3-amine structure
|
Common Name | 7-Methyl-2-phenylimidazo[1,2-a]pyridin-3-amine | ||
|---|---|---|---|---|
| CAS Number | 89185-45-5 | Molecular Weight | 223.27300 | |
| Density | 1.21g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H13N3 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Name | 7-Methyl-2-phenylimidazo[1,2-a]pyridin-3-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Molecular Formula | C14H13N3 |
| Molecular Weight | 223.27300 |
| Exact Mass | 223.11100 |
| PSA | 43.32000 |
| LogP | 3.47310 |
| Index of Refraction | 1.663 |
| InChIKey | FBFCRKNRKASWEW-UHFFFAOYSA-N |
| SMILES | Cc1ccn2c(N)c(-c3ccccc3)nc2c1 |
|
~51%
7-Methyl-2-phen... CAS#:89185-45-5 |
| Literature: Teulade, Jean C.; Escale, Roger; Viols, Henry; Chapat, Jean P.; Grassy, Gerard; et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 11 p. 2663 - 2667 |
|
~%
7-Methyl-2-phen... CAS#:89185-45-5 |
| Literature: Teulade, Jean C.; Escale, Roger; Viols, Henry; Chapat, Jean P.; Grassy, Gerard; et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 11 p. 2663 - 2667 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Imidazo[1,2-a]pyridin-3-amine,7-methyl-2-phenyl |
| 3-amino-7-methylimidazo<1,2-a>pyridine |
| F1912-0018 |