(3,3,4,5,5,5-hexafluoro-2,2-dimethylpentyl)benzene structure
|
Common Name | (3,3,4,5,5,5-hexafluoro-2,2-dimethylpentyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 89185-59-1 | Molecular Weight | 284.24100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H14F6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3,3,4,5,5,5-hexafluoro-2,2-dimethylpentyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H14F6 |
|---|---|
| Molecular Weight | 284.24100 |
| Exact Mass | 284.10000 |
| LogP | 4.79100 |
| InChIKey | AMJQSEDUSUEOLE-UHFFFAOYSA-N |
| SMILES | CC(C)(Cc1ccccc1)C(F)(F)C(F)C(F)(F)F |
|
~22%
(3,3,4,5,5,5-he... CAS#:89185-59-1
Detail
|
| Literature: Haszeldine, Robert N.; Raynor, Clive M.; Tipping, Anthony E. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 11 p. 2801 - 2806 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Benzene,(3,3,4,5,5,5-hexafluoro-2,2-dimethylpentyl) |