3-(2-nitrophenyl)pentane-2,4-dione
3-(2-nitrophenyl)pentane-2,4-dione structure
|
Common Name | 3-(2-nitrophenyl)pentane-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 89185-84-2 | Molecular Weight | 221.20900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(2-nitrophenyl)pentane-2,4-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H11NO4 |
|---|---|
| Molecular Weight | 221.20900 |
| Exact Mass | 221.06900 |
| PSA | 79.96000 |
| LogP | 2.37960 |
| InChIKey | CBYZMHCTWCVYKF-UHFFFAOYSA-N |
| SMILES | CC(=O)C(C(C)=O)c1ccccc1[N+](=O)[O-] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~38%
3-(2-nitropheny... CAS#:89185-84-2 |
| Literature: Citterio, Attilio; Ferrario, Francesco Journal of Chemical Research, Miniprint, 1983 , # 12 p. 2656 - 2668 |
|
~%
3-(2-nitropheny... CAS#:89185-84-2 |
| Literature: Dell'Erba; Novi; Petrillo; Tavani; Bellandi Tetrahedron, 1991 , vol. 47, # 2 p. 333 - 342 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 3-(2-nitrophenyl)pentane-2,4-dione? |
| A: InChIKey of 3-(2-nitrophenyl)pentane-2,4-dione is CBYZMHCTWCVYKF-UHFFFAOYSA-N. |
| Q: What are the upstream materials of 3-(2-nitrophenyl)pentane-2,4-dione? |
| A: Related upstream materials(CAS) of 3-(2-nitrophenyl)pentane-2,4-dione: 365-33-3;123-54-6. |
| Q: What is the Chinese name of 89185-84-2? |
| A: Chinese name of 89185-84-2 is 89185-84-2. |
| Q: What is the SMILES notation of 3-(2-nitrophenyl)pentane-2,4-dione? |
| A: SMILES notation of 3-(2-nitrophenyl)pentane-2,4-dione is CC(=O)C(C(C)=O)c1ccccc1[N+](=O)[O-]. |
| Q: What is the English name of 3-(2-nitrophenyl)pentane-2,4-dione? |
| A: The English name of 3-(2-nitrophenyl)pentane-2,4-dione is 3-(2-nitrophenyl)pentane-2,4-dione. |
| Q: What is the molecular weight of 3-(2-nitrophenyl)pentane-2,4-dione? |
| A: Molecular weight of 3-(2-nitrophenyl)pentane-2,4-dione is 221.20900. |
| Q: What is the LogP of 3-(2-nitrophenyl)pentane-2,4-dione? |
| A: LogP of 3-(2-nitrophenyl)pentane-2,4-dione is 2.37960. |
| Q: What is the molecular formula of 3-(2-nitrophenyl)pentane-2,4-dione? |
| A: Molecular formula of 3-(2-nitrophenyl)pentane-2,4-dione is C11H11NO4. |
| Q: What is the CAS number of 3-(2-nitrophenyl)pentane-2,4-dione? |
| A: CAS number of 3-(2-nitrophenyl)pentane-2,4-dione is 89185-84-2. |
| Q: What is the polar surface area (PSA) of 3-(2-nitrophenyl)pentane-2,4-dione? |
| A: Polar surface area (PSA) of 3-(2-nitrophenyl)pentane-2,4-dione is 79.96000. |