Hexacyprone structure
|
Common Name | Hexacyprone | ||
|---|---|---|---|---|
| CAS Number | 892-01-3 | Molecular Weight | 260.32800 | |
| Density | 1.139g/cm3 | Boiling Point | 439.1ºC at 760 mmHg | |
| Molecular Formula | C16H20O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.5ºC | |
| Name | 3-(1-benzyl-2-oxocyclohexyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.139g/cm3 |
|---|---|
| Boiling Point | 439.1ºC at 760 mmHg |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.32800 |
| Flash Point | 233.5ºC |
| Exact Mass | 260.14100 |
| PSA | 54.37000 |
| LogP | 3.22340 |
| Index of Refraction | 1.546 |
| InChIKey | QQWBGHWKTDIMCX-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC1(Cc2ccccc2)CCCCC1=O |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| HS Code | 2918300090 |
|---|
|
~%
Hexacyprone CAS#:892-01-3 |
| Literature: Fusco,R. et al. Farmaco, Edizione Scientifica, 1965 , vol. 20, p. 393 - 407 |
|
~%
Hexacyprone CAS#:892-01-3 |
| Literature: Fusco,R. et al. Farmaco, Edizione Scientifica, 1965 , vol. 20, p. 393 - 407 |
|
~%
Hexacyprone CAS#:892-01-3 |
| Literature: Fusco,R. et al. Farmaco, Edizione Scientifica, 1965 , vol. 20, p. 393 - 407 |
|
~%
Hexacyprone CAS#:892-01-3 |
| Literature: Fusco,R. et al. Farmaco, Edizione Scientifica, 1965 , vol. 20, p. 393 - 407 |
|
~%
Hexacyprone CAS#:892-01-3 |
| Literature: Fusco,R. et al. Farmaco, Edizione Scientifica, 1965 , vol. 20, p. 393 - 407 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Hexaciprono [INN-Spanish] |
| 1-Benzyl-2-oxo-cyclohexanepropionic acid |
| Cyclohexanepropionic acid,1-benzyl-2-oxo |
| Hexacypronum [INN-Latin] |
| Hexacyprone |
| 3-<1-Benzyl-2-oxo-cyclohexyl>-propionsaeure |
| Esaciprone [DCIT] |
| 2-Oxo-1-benzylcyclohexylpropionsaeure |