diethyl 2-phenacylidenepropanedioate
diethyl 2-phenacylidenepropanedioate structure
|
Common Name | diethyl 2-phenacylidenepropanedioate | ||
|---|---|---|---|---|
| CAS Number | 89201-08-1 | Molecular Weight | 276.28500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | diethyl 2-phenacylidenepropanedioate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H16O5 |
|---|---|
| Molecular Weight | 276.28500 |
| Exact Mass | 276.10000 |
| PSA | 69.67000 |
| LogP | 1.92190 |
| InChIKey | SUHJOWTVHNNZAH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=CC(=O)c1ccccc1)C(=O)OCC |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:71897-07-9
CAS#:5021-43-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Propanedioic acid,(2-oxo-2-phenylethylidene)-,diethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of diethyl 2-phenacylidenepropanedioate? |
| A: Molecular formula of diethyl 2-phenacylidenepropanedioate is C15H16O5. |
| Q: What is the CAS number of diethyl 2-phenacylidenepropanedioate? |
| A: CAS number of diethyl 2-phenacylidenepropanedioate is 89201-08-1. |
| Q: What is the molecular weight of diethyl 2-phenacylidenepropanedioate? |
| A: Molecular weight of diethyl 2-phenacylidenepropanedioate is 276.28500. |
| Q: What English synonyms does diethyl 2-phenacylidenepropanedioate have? |
| A: English synonyms of diethyl 2-phenacylidenepropanedioate: Propanedioic acid,(2-oxo-2-phenylethylidene)-,diethyl ester. |
| Q: What is the Chinese name of 89201-08-1? |
| A: Chinese name of 89201-08-1 is 89201-08-1. |
| Q: What are the downstream products of diethyl 2-phenacylidenepropanedioate? |
| A: Related downstream products(CAS) of diethyl 2-phenacylidenepropanedioate: 71897-07-9;5021-43-2. |
| Q: What is the polar surface area (PSA) of diethyl 2-phenacylidenepropanedioate? |
| A: Polar surface area (PSA) of diethyl 2-phenacylidenepropanedioate is 69.67000. |
| Q: What is the English name of diethyl 2-phenacylidenepropanedioate? |
| A: The English name of diethyl 2-phenacylidenepropanedioate is diethyl 2-phenacylidenepropanedioate. |
| Q: What is the SMILES notation of diethyl 2-phenacylidenepropanedioate? |
| A: SMILES notation of diethyl 2-phenacylidenepropanedioate is CCOC(=O)C(=CC(=O)c1ccccc1)C(=O)OCC. |
| Q: What is the LogP of diethyl 2-phenacylidenepropanedioate? |
| A: LogP of diethyl 2-phenacylidenepropanedioate is 1.92190. |