2,4-dimethyl-N-phenylpyrazole-3-carboxamide structure
|
Common Name | 2,4-dimethyl-N-phenylpyrazole-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 89202-85-7 | Molecular Weight | 215.25100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,4-dimethyl-N-phenylpyrazole-3-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H13N3O |
|---|---|
| Molecular Weight | 215.25100 |
| Exact Mass | 215.10600 |
| PSA | 46.92000 |
| LogP | 2.05380 |
| InChIKey | QWAUUJBPUPKHTI-UHFFFAOYSA-N |
| SMILES | Cc1cnn(C)c1C(=O)Nc1ccccc1 |
|
~%
2,4-dimethyl-N-... CAS#:89202-85-7 |
| Literature: Huppatz; Phillips; Witrzens Agricultural and Biological Chemistry, 1984 , vol. 48, # 1 p. 45 - 50 |
|
~%
2,4-dimethyl-N-... CAS#:89202-85-7 |
| Literature: Huppatz; Phillips; Witrzens Agricultural and Biological Chemistry, 1984 , vol. 48, # 1 p. 45 - 50 |
|
~%
2,4-dimethyl-N-... CAS#:89202-85-7 |
| Literature: Huppatz; Phillips; Witrzens Agricultural and Biological Chemistry, 1984 , vol. 48, # 1 p. 45 - 50 |
|
~%
2,4-dimethyl-N-... CAS#:89202-85-7 |
| Literature: Huppatz; Phillips; Witrzens Agricultural and Biological Chemistry, 1984 , vol. 48, # 1 p. 45 - 50 |
| 1H-Pyrazole-5-carboxamide,1,4-dimethyl-N-phenyl |
| 2,4-dimethyl-2H-pyrazole-3-carboxylic acid anilide |
| N-Phenyl-1,4-dimethylpyrazole-5-carboxamide |
| 2,4-Dimethyl-2H-pyrazol-3-carbonsaeure-anilid |