N-methyl-5-(3,4,5-trimethoxyphenyl)-1,3-oxazole-4-carboxamide structure
|
Common Name | N-methyl-5-(3,4,5-trimethoxyphenyl)-1,3-oxazole-4-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 89205-16-3 | Molecular Weight | 292.28700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-methyl-5-(3,4,5-trimethoxyphenyl)-1,3-oxazole-4-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H16N2O5 |
|---|---|
| Molecular Weight | 292.28700 |
| Exact Mass | 292.10600 |
| PSA | 86.31000 |
| LogP | 2.30180 |
| InChIKey | BIXMMWOGCOODBF-UHFFFAOYSA-N |
| SMILES | CNC(=O)c1ncoc1-c1cc(OC)c(OC)c(OC)c1 |
|
~%
N-methyl-5-(3,4... CAS#:89205-16-3 |
| Literature: Ozaki; Maeda; Iwasaki; Matsumoto; Odawara; Sasaki; Morita Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 12 p. 4417 - 4424 |
|
~%
N-methyl-5-(3,4... CAS#:89205-16-3 |
| Literature: Ozaki; Maeda; Iwasaki; Matsumoto; Odawara; Sasaki; Morita Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 12 p. 4417 - 4424 |
|
~%
N-methyl-5-(3,4... CAS#:89205-16-3 |
| Literature: Ozaki; Maeda; Iwasaki; Matsumoto; Odawara; Sasaki; Morita Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 12 p. 4417 - 4424 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-Oxazolecarboxamide,N-methyl-5-(3,4,5-trimethoxyphenyl) |