2-cyclohexyl-5-(3,4,5-trimethoxyphenyl)-1,3-oxazole-4-carboxamide structure
|
Common Name | 2-cyclohexyl-5-(3,4,5-trimethoxyphenyl)-1,3-oxazole-4-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 89205-23-2 | Molecular Weight | 360.40400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H24N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-cyclohexyl-5-(3,4,5-trimethoxyphenyl)-1,3-oxazole-4-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H24N2O5 |
|---|---|
| Molecular Weight | 360.40400 |
| Exact Mass | 360.16900 |
| PSA | 97.80000 |
| LogP | 4.39820 |
| InChIKey | YLBADOGZJCMKQD-UHFFFAOYSA-N |
| SMILES | COc1cc(-c2oc(C3CCCCC3)nc2C(N)=O)cc(OC)c1OC |
|
~%
2-cyclohexyl-5-... CAS#:89205-23-2 |
| Literature: Ozaki; Maeda; Iwasaki; Matsumoto; Odawara; Sasaki; Morita Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 12 p. 4417 - 4424 |
|
~%
2-cyclohexyl-5-... CAS#:89205-23-2 |
| Literature: Ozaki; Maeda; Iwasaki; Matsumoto; Odawara; Sasaki; Morita Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 12 p. 4417 - 4424 |
|
~%
2-cyclohexyl-5-... CAS#:89205-23-2 |
| Literature: Ozaki; Maeda; Iwasaki; Matsumoto; Odawara; Sasaki; Morita Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 12 p. 4417 - 4424 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4-Oxazolecarboxamide,2-cyclohexyl-5-(3,4,5-trimethoxyphenyl) |