4-(4-ethyl-2,6-dimethylphenoxy)-2-phenylquinazoline
4-(4-ethyl-2,6-dimethylphenoxy)-2-phenylquinazoline structure
|
Common Name | 4-(4-ethyl-2,6-dimethylphenoxy)-2-phenylquinazoline | ||
|---|---|---|---|---|
| CAS Number | 89210-32-2 | Molecular Weight | 354.44400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H22N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(4-ethyl-2,6-dimethylphenoxy)-2-phenylquinazoline |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C24H22N2O |
|---|---|
| Molecular Weight | 354.44400 |
| Exact Mass | 354.17300 |
| PSA | 35.01000 |
| LogP | 6.26830 |
| InChIKey | PIXIWUJCYCAMKG-UHFFFAOYSA-N |
| SMILES | CCc1cc(C)c(Oc2nc(-c3ccccc3)nc3ccccc23)c(C)c1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:89210-33-3This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Quinazoline,4-(4-ethyl-2,6-dimethylphenoxy)-2-phenyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 4-(4-ethyl-2,6-dimethylphenoxy)-2-phenylquinazoline? |
| A: LogP of 4-(4-ethyl-2,6-dimethylphenoxy)-2-phenylquinazoline is 6.26830. |
| Q: What is the molecular formula of 4-(4-ethyl-2,6-dimethylphenoxy)-2-phenylquinazoline? |
| A: Molecular formula of 4-(4-ethyl-2,6-dimethylphenoxy)-2-phenylquinazoline is C24H22N2O. |
| Q: What is the Chinese name of 89210-32-2? |
| A: Chinese name of 89210-32-2 is 89210-32-2. |
| Q: What are the downstream products of 4-(4-ethyl-2,6-dimethylphenoxy)-2-phenylquinazoline? |
| A: Related downstream products(CAS) of 4-(4-ethyl-2,6-dimethylphenoxy)-2-phenylquinazoline: 89210-33-3. |
| Q: What is the CAS number of 4-(4-ethyl-2,6-dimethylphenoxy)-2-phenylquinazoline? |
| A: CAS number of 4-(4-ethyl-2,6-dimethylphenoxy)-2-phenylquinazoline is 89210-32-2. |
| Q: What is the SMILES notation of 4-(4-ethyl-2,6-dimethylphenoxy)-2-phenylquinazoline? |
| A: SMILES notation of 4-(4-ethyl-2,6-dimethylphenoxy)-2-phenylquinazoline is CCc1cc(C)c(Oc2nc(-c3ccccc3)nc3ccccc23)c(C)c1. |
| Q: What is the molecular weight of 4-(4-ethyl-2,6-dimethylphenoxy)-2-phenylquinazoline? |
| A: Molecular weight of 4-(4-ethyl-2,6-dimethylphenoxy)-2-phenylquinazoline is 354.44400. |
| Q: What English synonyms does 4-(4-ethyl-2,6-dimethylphenoxy)-2-phenylquinazoline have? |
| A: English synonyms of 4-(4-ethyl-2,6-dimethylphenoxy)-2-phenylquinazoline: Quinazoline,4-(4-ethyl-2,6-dimethylphenoxy)-2-phenyl. |
| Q: What is the polar surface area (PSA) of 4-(4-ethyl-2,6-dimethylphenoxy)-2-phenylquinazoline? |
| A: Polar surface area (PSA) of 4-(4-ethyl-2,6-dimethylphenoxy)-2-phenylquinazoline is 35.01000. |
| Q: What is the InChIKey of 4-(4-ethyl-2,6-dimethylphenoxy)-2-phenylquinazoline? |
| A: InChIKey of 4-(4-ethyl-2,6-dimethylphenoxy)-2-phenylquinazoline is PIXIWUJCYCAMKG-UHFFFAOYSA-N. |