2-chloro-1-(3-diethoxyphosphorylpropoxy)-4-methoxybenzene structure
|
Common Name | 2-chloro-1-(3-diethoxyphosphorylpropoxy)-4-methoxybenzene | ||
|---|---|---|---|---|
| CAS Number | 89210-90-2 | Molecular Weight | 336.74800 | |
| Density | 1.18g/cm3 | Boiling Point | 448.2ºC at 760 mmHg | |
| Molecular Formula | C14H22ClO5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 365.7ºC | |
| Name | 2-chloro-1-(3-diethoxyphosphorylpropoxy)-4-methoxybenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 448.2ºC at 760 mmHg |
| Molecular Formula | C14H22ClO5P |
| Molecular Weight | 336.74800 |
| Flash Point | 365.7ºC |
| Exact Mass | 336.08900 |
| PSA | 63.80000 |
| LogP | 4.38360 |
| Index of Refraction | 1.491 |
| InChIKey | WDTUXIPXTSGROZ-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(CCCOc1ccc(OC)cc1Cl)OCC |
|
~65%
2-chloro-1-(3-d... CAS#:89210-90-2 |
| Literature: Diana, G. D.; Zalay, E. S.; Salvador, U. J.; Pancic, F.; Steinberg, B. Journal of Medicinal Chemistry, 1984 , vol. 27, # 5 p. 691 - 694 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: In vitro ability to inhibit the herpes HSV-2 virus; Inactive
Source: ChEMBL
Target: Oryctolagus cuniculus
External Id: CHEMBL695782
|
| Phosphonic acid,(3-(2-chloro-4-methoxyphenoxy)propyl)-,diethyl ester |