1-chloro-4-(6-diethoxyphosphorylhexoxy)benzene structure
|
Common Name | 1-chloro-4-(6-diethoxyphosphorylhexoxy)benzene | ||
|---|---|---|---|---|
| CAS Number | 89210-96-8 | Molecular Weight | 348.80200 | |
| Density | 1.122g/cm3 | Boiling Point | 449.7ºC at 760 mmHg | |
| Molecular Formula | C16H26ClO4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 367.7ºC | |
| Name | 1-chloro-4-(6-diethoxyphosphorylhexoxy)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.122g/cm3 |
|---|---|
| Boiling Point | 449.7ºC at 760 mmHg |
| Molecular Formula | C16H26ClO4P |
| Molecular Weight | 348.80200 |
| Flash Point | 367.7ºC |
| Exact Mass | 348.12600 |
| PSA | 54.57000 |
| LogP | 5.54530 |
| Index of Refraction | 1.49 |
| InChIKey | GSNSJLNKHZFGRG-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(CCCCCCOc1ccc(Cl)cc1)OCC |
|
~64%
1-chloro-4-(6-d... CAS#:89210-96-8 |
| Literature: Diana, G. D.; Zalay, E. S.; Salvador, U. J.; Pancic, F.; Steinberg, B. Journal of Medicinal Chemistry, 1984 , vol. 27, # 5 p. 691 - 694 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: In vitro ability to inhibit the herpes HSV-2 virus; Inactive
Source: ChEMBL
Target: Oryctolagus cuniculus
External Id: CHEMBL695782
|
| Phosphonic acid,(6-(4-chlorophenoxy)hexyl)-,diethyl ester |