ATTO 425 maleimide
Modify Date: 2025-09-18 16:37:21
ATTO 425 maleimide structure
|
Common Name | ATTO 425 maleimide | ||
|---|---|---|---|---|
| CAS Number | 892156-52-4 | Molecular Weight | 523.58 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H33N3O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of ATTO 425 maleimideATTO 425 Maleimide is a maleimide ester derivative of ATTO 425, which can be used to label proteins or antibodies. The maximum excitation emission wavelength: 439/489 nm. |
| Name | ATTO 425 maleimide |
|---|
| Description | ATTO 425 Maleimide is a maleimide ester derivative of ATTO 425, which can be used to label proteins or antibodies. The maximum excitation emission wavelength: 439/489 nm. |
|---|---|
| Related Catalog |
| Molecular Formula | C28H33N3O7 |
|---|---|
| Molecular Weight | 523.58 |
| InChIKey | CUWXBTJMNRLPKT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc2cc3c(cc2oc1=O)N(CCCC(=O)NCCN1C(=O)C=CC1=O)C(C)(C)CC3C |