3-methoxy-4-phenyl-2-(2H-tetrazol-5-yl)furo[3,2-b]indole structure
|
Common Name | 3-methoxy-4-phenyl-2-(2H-tetrazol-5-yl)furo[3,2-b]indole | ||
|---|---|---|---|---|
| CAS Number | 89224-82-8 | Molecular Weight | 331.32800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H13N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-methoxy-4-phenyl-2-(2H-tetrazol-5-yl)furo[3,2-b]indole |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H13N5O2 |
|---|---|
| Molecular Weight | 331.32800 |
| Exact Mass | 331.10700 |
| PSA | 81.76000 |
| LogP | 3.56540 |
| InChIKey | PWSDIAIDLOFYPB-UHFFFAOYSA-N |
| SMILES | COc1c(-c2nn[nH]n2)oc2c3ccccc3n(-c3ccccc3)c12 |
|
~29%
3-methoxy-4-phe... CAS#:89224-82-8 |
| Literature: Unangst; Carethers; Webster; Janik; Robichaud Journal of Medicinal Chemistry, 1984 , vol. 27, # 12 p. 1629 - 1633 |
|
~%
3-methoxy-4-phe... CAS#:89224-82-8 |
| Literature: Unangst; Carethers; Webster; Janik; Robichaud Journal of Medicinal Chemistry, 1984 , vol. 27, # 12 p. 1629 - 1633 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-Methoxy-4-phenyl-2-(1H-tetrazol-5-yl)-4H-furo[3,2-b]-indole |
| 4H-Furo[3,2-b]indole,3-methoxy-4-phenyl-2-(1H-tetrazol-5-yl) |