1-(1-methylcyclopropyl)-1-phenylpropan-2-one
1-(1-methylcyclopropyl)-1-phenylpropan-2-one structure
|
Common Name | 1-(1-methylcyclopropyl)-1-phenylpropan-2-one | ||
|---|---|---|---|---|
| CAS Number | 89237-93-4 | Molecular Weight | 188.26600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(1-methylcyclopropyl)-1-phenylpropan-2-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H16O |
|---|---|
| Molecular Weight | 188.26600 |
| Exact Mass | 188.12000 |
| PSA | 17.07000 |
| LogP | 3.15930 |
| InChIKey | HHBMEIFYVBRKKQ-UHFFFAOYSA-N |
| SMILES | CC(=O)C(c1ccccc1)C1(C)CC1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1-(1-methylcycl... CAS#:89237-93-4 |
| Literature: Lechevallier, A.; Huet, F.; Conia, J.M. Tetrahedron, 1983 , vol. 39, # 20 p. 3317 - 3328 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (methyl-1 cyclopropyl)-1 phenyl-1 propanone |
| 2-Propanone,1-(1-methylcyclopropyl)-1-phenyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 1-(1-methylcyclopropyl)-1-phenylpropan-2-one? |
| A: CAS number of 1-(1-methylcyclopropyl)-1-phenylpropan-2-one is 89237-93-4. |
| Q: What is the molecular formula of 1-(1-methylcyclopropyl)-1-phenylpropan-2-one? |
| A: Molecular formula of 1-(1-methylcyclopropyl)-1-phenylpropan-2-one is C13H16O. |
| Q: What is the polar surface area (PSA) of 1-(1-methylcyclopropyl)-1-phenylpropan-2-one? |
| A: Polar surface area (PSA) of 1-(1-methylcyclopropyl)-1-phenylpropan-2-one is 17.07000. |
| Q: What are the upstream materials of 1-(1-methylcyclopropyl)-1-phenylpropan-2-one? |
| A: Related upstream materials(CAS) of 1-(1-methylcyclopropyl)-1-phenylpropan-2-one: 917-64-6;89237-70-7. |
| Q: What is the Chinese name of 89237-93-4? |
| A: Chinese name of 89237-93-4 is 89237-93-4. |
| Q: What English synonyms does 1-(1-methylcyclopropyl)-1-phenylpropan-2-one have? |
| A: English synonyms of 1-(1-methylcyclopropyl)-1-phenylpropan-2-one: (methyl-1 cyclopropyl)-1 phenyl-1 propanone, 2-Propanone,1-(1-methylcyclopropyl)-1-phenyl. |
| Q: What is the InChIKey of 1-(1-methylcyclopropyl)-1-phenylpropan-2-one? |
| A: InChIKey of 1-(1-methylcyclopropyl)-1-phenylpropan-2-one is HHBMEIFYVBRKKQ-UHFFFAOYSA-N. |
| Q: What is the LogP of 1-(1-methylcyclopropyl)-1-phenylpropan-2-one? |
| A: LogP of 1-(1-methylcyclopropyl)-1-phenylpropan-2-one is 3.15930. |
| Q: What is the molecular weight of 1-(1-methylcyclopropyl)-1-phenylpropan-2-one? |
| A: Molecular weight of 1-(1-methylcyclopropyl)-1-phenylpropan-2-one is 188.26600. |
| Q: What is the English name of 1-(1-methylcyclopropyl)-1-phenylpropan-2-one? |
| A: The English name of 1-(1-methylcyclopropyl)-1-phenylpropan-2-one is 1-(1-methylcyclopropyl)-1-phenylpropan-2-one. |