trimethyl-(2-pyridin-2-yl-5-trimethylsilylfuran-3-yl)silane
trimethyl-(2-pyridin-2-yl-5-trimethylsilylfuran-3-yl)silane structure
|
Common Name | trimethyl-(2-pyridin-2-yl-5-trimethylsilylfuran-3-yl)silane | ||
|---|---|---|---|---|
| CAS Number | 89275-68-3 | Molecular Weight | 289.52000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H23NOSi2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | trimethyl-(2-pyridin-2-yl-5-trimethylsilylfuran-3-yl)silane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H23NOSi2 |
|---|---|
| Molecular Weight | 289.52000 |
| Exact Mass | 289.13200 |
| PSA | 26.03000 |
| LogP | 3.43200 |
| InChIKey | AWKHCOXENXOLIQ-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)c1cc([Si](C)(C)C)c(-c2ccccn2)o1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
trimethyl-(2-py... CAS#:89275-68-3 |
| Literature: Ribereau, P.; Queguiner, G. Tetrahedron, 1983 , vol. 39, # 21 p. 3593 - 3602 |
|
~%
trimethyl-(2-py... CAS#:89275-68-3 |
| Literature: Ribereau, P.; Queguiner, G. Tetrahedron, 1983 , vol. 39, # 21 p. 3593 - 3602 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of trimethyl-(2-pyridin-2-yl-5-trimethylsilylfuran-3-yl)silane? |
| A: Molecular formula of trimethyl-(2-pyridin-2-yl-5-trimethylsilylfuran-3-yl)silane is C15H23NOSi2. |
| Q: What is the Chinese name of 89275-68-3? |
| A: Chinese name of 89275-68-3 is 89275-68-3. |
| Q: What is the polar surface area (PSA) of trimethyl-(2-pyridin-2-yl-5-trimethylsilylfuran-3-yl)silane? |
| A: Polar surface area (PSA) of trimethyl-(2-pyridin-2-yl-5-trimethylsilylfuran-3-yl)silane is 26.03000. |
| Q: What are the upstream materials of trimethyl-(2-pyridin-2-yl-5-trimethylsilylfuran-3-yl)silane? |
| A: Related upstream materials(CAS) of trimethyl-(2-pyridin-2-yl-5-trimethylsilylfuran-3-yl)silane: 75-77-4;55484-03-2. |
| Q: What is the CAS number of trimethyl-(2-pyridin-2-yl-5-trimethylsilylfuran-3-yl)silane? |
| A: CAS number of trimethyl-(2-pyridin-2-yl-5-trimethylsilylfuran-3-yl)silane is 89275-68-3. |
| Q: What is the English name of trimethyl-(2-pyridin-2-yl-5-trimethylsilylfuran-3-yl)silane? |
| A: The English name of trimethyl-(2-pyridin-2-yl-5-trimethylsilylfuran-3-yl)silane is trimethyl-(2-pyridin-2-yl-5-trimethylsilylfuran-3-yl)silane. |
| Q: What is the InChIKey of trimethyl-(2-pyridin-2-yl-5-trimethylsilylfuran-3-yl)silane? |
| A: InChIKey of trimethyl-(2-pyridin-2-yl-5-trimethylsilylfuran-3-yl)silane is AWKHCOXENXOLIQ-UHFFFAOYSA-N. |
| Q: What is the molecular weight of trimethyl-(2-pyridin-2-yl-5-trimethylsilylfuran-3-yl)silane? |
| A: Molecular weight of trimethyl-(2-pyridin-2-yl-5-trimethylsilylfuran-3-yl)silane is 289.52000. |
| Q: What is the SMILES notation of trimethyl-(2-pyridin-2-yl-5-trimethylsilylfuran-3-yl)silane? |
| A: SMILES notation of trimethyl-(2-pyridin-2-yl-5-trimethylsilylfuran-3-yl)silane is C[Si](C)(C)c1cc([Si](C)(C)C)c(-c2ccccn2)o1. |
| Q: What is the LogP of trimethyl-(2-pyridin-2-yl-5-trimethylsilylfuran-3-yl)silane? |
| A: LogP of trimethyl-(2-pyridin-2-yl-5-trimethylsilylfuran-3-yl)silane is 3.43200. |