N-methyl-5-nitro-1,3-benzoxazol-2-amine
Modify Date: 2025-10-06 18:15:04
N-methyl-5-nitro-1,3-benzoxazol-2-amine structure
|
Common Name | N-methyl-5-nitro-1,3-benzoxazol-2-amine | ||
|---|---|---|---|---|
| CAS Number | 892841-89-3 | Molecular Weight | 193.16 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H7N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-methyl-5-nitro-1,3-benzoxazol-2-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H7N3O3 |
|---|---|
| Molecular Weight | 193.16 |
| InChIKey | TXDXBAGPLUULRS-UHFFFAOYSA-N |
| SMILES | CNc1nc2cc([N+](=O)[O-])ccc2o1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of N-methyl-5-nitro-1,3-benzoxazol-2-amine? |
| A: InChIKey of N-methyl-5-nitro-1,3-benzoxazol-2-amine is TXDXBAGPLUULRS-UHFFFAOYSA-N. |
| Q: What is the molecular formula of N-methyl-5-nitro-1,3-benzoxazol-2-amine? |
| A: Molecular formula of N-methyl-5-nitro-1,3-benzoxazol-2-amine is C8H7N3O3. |
| Q: What is the English name of N-methyl-5-nitro-1,3-benzoxazol-2-amine? |
| A: The English name of N-methyl-5-nitro-1,3-benzoxazol-2-amine is N-methyl-5-nitro-1,3-benzoxazol-2-amine. |
| Q: What is the CAS number of N-methyl-5-nitro-1,3-benzoxazol-2-amine? |
| A: CAS number of N-methyl-5-nitro-1,3-benzoxazol-2-amine is 892841-89-3. |
| Q: What is the molecular weight of N-methyl-5-nitro-1,3-benzoxazol-2-amine? |
| A: Molecular weight of N-methyl-5-nitro-1,3-benzoxazol-2-amine is 193.16. |
| Q: What is the Chinese name of 892841-89-3? |
| A: Chinese name of 892841-89-3 is 892841-89-3. |
| Q: What is the SMILES notation of N-methyl-5-nitro-1,3-benzoxazol-2-amine? |
| A: SMILES notation of N-methyl-5-nitro-1,3-benzoxazol-2-amine is CNc1nc2cc([N+](=O)[O-])ccc2o1. |