tenylidone
tenylidone structure
|
Common Name | tenylidone | ||
|---|---|---|---|---|
| CAS Number | 893-01-6 | Molecular Weight | 286.41200 | |
| Density | 1.316g/cm3 | Boiling Point | 488.2ºC at 760 mmHg | |
| Molecular Formula | C16H14OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.1ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tenylidone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.316g/cm3 |
|---|---|
| Boiling Point | 488.2ºC at 760 mmHg |
| Molecular Formula | C16H14OS2 |
| Molecular Weight | 286.41200 |
| Flash Point | 249.1ºC |
| Exact Mass | 286.04900 |
| PSA | 73.55000 |
| LogP | 5.02960 |
| Index of Refraction | 1.719 |
| InChIKey | KHXBULXCCPIELT-DCIPZJNNSA-N |
| SMILES | O=C1C(=Cc2cccs2)CCCC1=Cc1cccs1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2934999090 |
|---|
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,6-bis[(E)-(2-thienyl)methylidene]cyclohexanone |
| 2,6-bis-[2]thienylmethylene-cyclohexanone |
| 2,6-bis-thiophen-2-ylmethylene-cyclohexanone |
| (2E,6E)-2,6-bis(2-thienylmethylene)cyclohexanone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of tenylidone? |
| A: CAS number of tenylidone is 893-01-6. |
| Q: What is the polar surface area (PSA) of tenylidone? |
| A: Polar surface area (PSA) of tenylidone is 73.55000. |
| Q: What is the InChIKey of tenylidone? |
| A: InChIKey of tenylidone is KHXBULXCCPIELT-DCIPZJNNSA-N. |
| Q: What English synonyms does tenylidone have? |
| A: English synonyms of tenylidone: 2,6-bis[(E)-(2-thienyl)methylidene]cyclohexanone, 2,6-bis-[2]thienylmethylene-cyclohexanone, 2,6-bis-thiophen-2-ylmethylene-cyclohexanone, (2E,6E)-2,6-bis(2-thienylmethylene)cyclohexanone. |
| Q: What is the SMILES notation of tenylidone? |
| A: SMILES notation of tenylidone is O=C1C(=Cc2cccs2)CCCC1=Cc1cccs1. |
| Q: What is the molecular weight of tenylidone? |
| A: Molecular weight of tenylidone is 286.41200. |
| Q: What is the boiling point of tenylidone? |
| A: Boiling point of tenylidone is 488.2ºC at 760 mmHg. |
| Q: What is the LogP of tenylidone? |
| A: LogP of tenylidone is 5.02960. |
| Q: What is the English name of tenylidone? |
| A: The English name of tenylidone is tenylidone. |
| Q: What is the molecular formula of tenylidone? |
| A: Molecular formula of tenylidone is C16H14OS2. |