tert-butyl 1,4-dihydronaphthalene-1-carboxylate
tert-butyl 1,4-dihydronaphthalene-1-carboxylate structure
|
Common Name | tert-butyl 1,4-dihydronaphthalene-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 89302-36-3 | Molecular Weight | 230.30200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-butyl 1,4-dihydronaphthalene-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H18O2 |
|---|---|
| Molecular Weight | 230.30200 |
| Exact Mass | 230.13100 |
| PSA | 26.30000 |
| LogP | 3.22420 |
| InChIKey | ZIWFSPKXRWKTDL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1C=CCc2ccccc21 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~41%
tert-butyl 1,4-... CAS#:89302-36-3 |
| Literature: Rabideau, Peter W.; Wetzel, Donna M.; Young, Michael D. Journal of Organic Chemistry, 1984 , vol. 49, p. 1544 - 1549 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| tert-butyl 1,4-dihydro-1-naphthoate |
| 1-Naphthalenecarboxylic acid,1,4-dihydro-,1,1-dimethylethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of tert-butyl 1,4-dihydronaphthalene-1-carboxylate? |
| A: SMILES notation of tert-butyl 1,4-dihydronaphthalene-1-carboxylate is CC(C)(C)OC(=O)C1C=CCc2ccccc21. |
| Q: What English synonyms does tert-butyl 1,4-dihydronaphthalene-1-carboxylate have? |
| A: English synonyms of tert-butyl 1,4-dihydronaphthalene-1-carboxylate: tert-butyl 1,4-dihydro-1-naphthoate, 1-Naphthalenecarboxylic acid,1,4-dihydro-,1,1-dimethylethyl ester. |
| Q: What is the English name of tert-butyl 1,4-dihydronaphthalene-1-carboxylate? |
| A: The English name of tert-butyl 1,4-dihydronaphthalene-1-carboxylate is tert-butyl 1,4-dihydronaphthalene-1-carboxylate. |
| Q: What are the upstream materials of tert-butyl 1,4-dihydronaphthalene-1-carboxylate? |
| A: Related upstream materials(CAS) of tert-butyl 1,4-dihydronaphthalene-1-carboxylate: 66821-79-2. |
| Q: What is the CAS number of tert-butyl 1,4-dihydronaphthalene-1-carboxylate? |
| A: CAS number of tert-butyl 1,4-dihydronaphthalene-1-carboxylate is 89302-36-3. |
| Q: What is the InChIKey of tert-butyl 1,4-dihydronaphthalene-1-carboxylate? |
| A: InChIKey of tert-butyl 1,4-dihydronaphthalene-1-carboxylate is ZIWFSPKXRWKTDL-UHFFFAOYSA-N. |
| Q: What is the molecular weight of tert-butyl 1,4-dihydronaphthalene-1-carboxylate? |
| A: Molecular weight of tert-butyl 1,4-dihydronaphthalene-1-carboxylate is 230.30200. |
| Q: What is the LogP of tert-butyl 1,4-dihydronaphthalene-1-carboxylate? |
| A: LogP of tert-butyl 1,4-dihydronaphthalene-1-carboxylate is 3.22420. |
| Q: What is the molecular formula of tert-butyl 1,4-dihydronaphthalene-1-carboxylate? |
| A: Molecular formula of tert-butyl 1,4-dihydronaphthalene-1-carboxylate is C15H18O2. |
| Q: What is the Chinese name of 89302-36-3? |
| A: Chinese name of 89302-36-3 is 89302-36-3. |