tert-butyl 9,10-dihydroanthracene-9-carboxylate structure
|
Common Name | tert-butyl 9,10-dihydroanthracene-9-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 89302-39-6 | Molecular Weight | 280.36100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H20O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl 9,10-dihydroanthracene-9-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H20O2 |
|---|---|
| Molecular Weight | 280.36100 |
| Exact Mass | 280.14600 |
| PSA | 26.30000 |
| LogP | 4.06440 |
| InChIKey | JROFACYESGEFCN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1c2ccccc2Cc2ccccc21 |
|
~86%
tert-butyl 9,10... CAS#:89302-39-6 |
| Literature: Findlay, Neil J.; Park, Stuart R.; Schoenebeck, Franziska; Cahard, Elise; Zhou, Sheng-Ze; Berlouis, Leonard E. A.; Spicer, Mark D.; Tuttle, Tell; Murphy, John A. Journal of the American Chemical Society, 2010 , vol. 132, # 44 p. 15462 - 15464 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 9-Anthracenecarboxylic acid,9,10-dihydro-,1,1-dimethylethyl ester |
| tert-butyl 9,10-dihydroanthracene-10-carboxylate |
| tert-butyl 9,10-dihydro-9-anthroate |