1-nitro-3-propa-1,2-dienylbenzene structure
|
Common Name | 1-nitro-3-propa-1,2-dienylbenzene | ||
|---|---|---|---|---|
| CAS Number | 89302-80-7 | Molecular Weight | 161.15700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-nitro-3-propa-1,2-dienylbenzene |
|---|
| Molecular Formula | C9H7NO2 |
|---|---|
| Molecular Weight | 161.15700 |
| Exact Mass | 161.04800 |
| PSA | 45.82000 |
| LogP | 2.91610 |
| InChIKey | HWDPQURHKOCSJL-UHFFFAOYSA-N |
| SMILES | C=C=Cc1cccc([N+](=O)[O-])c1 |
|
~%
1-nitro-3-propa... CAS#:89302-80-7 |
| Literature: Rafizadeh, Karim; Yates, Keith Journal of Organic Chemistry, 1984 , vol. 49, # 9 p. 1500 - 1506 |
|
~%
1-nitro-3-propa... CAS#:89302-80-7 |
| Literature: Rafizadeh, Karim; Yates, Keith Journal of Organic Chemistry, 1984 , vol. 49, # 9 p. 1500 - 1506 |