1-(benzenesulfonylmethyl)-4-methylsulfonyl-2-nitrobenzene structure
|
Common Name | 1-(benzenesulfonylmethyl)-4-methylsulfonyl-2-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 89303-52-6 | Molecular Weight | 355.38600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H13NO6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(benzenesulfonylmethyl)-4-methylsulfonyl-2-nitrobenzene |
|---|
| Molecular Formula | C14H13NO6S2 |
|---|---|
| Molecular Weight | 355.38600 |
| Exact Mass | 355.01800 |
| PSA | 130.86000 |
| LogP | 4.65700 |
| InChIKey | BGGIDFSRJOHNOU-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1ccc(CS(=O)(=O)c2ccccc2)c([N+](=O)[O-])c1 |
|
~%
1-(benzenesulfo... CAS#:89303-52-6 |
| Literature: Makosza, Mieczyslaw; Golinski, Jerzy; Baran, Janusz Journal of Organic Chemistry, 1984 , vol. 49, # 9 p. 1488 - 1494 |
|
~%
1-(benzenesulfo... CAS#:89303-52-6 |
| Literature: Makosza, Mieczyslaw; Golinski, Jerzy; Baran, Janusz Journal of Organic Chemistry, 1984 , vol. 49, # 9 p. 1488 - 1494 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |