5-Nitro-2-tetralone
Modify Date: 2025-09-29 22:03:48
5-Nitro-2-tetralone structure
|
Common Name | 5-Nitro-2-tetralone | ||
|---|---|---|---|---|
| CAS Number | 89331-01-1 | Molecular Weight | 191.18300 | |
| Density | 1.322 g/cm3 | Boiling Point | 357.848ºC at 760 mmHg | |
| Molecular Formula | C10H9NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-nitro-3,4-dihydro-1H-naphthalen-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.322 g/cm3 |
|---|---|
| Boiling Point | 357.848ºC at 760 mmHg |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.18300 |
| Exact Mass | 191.05800 |
| PSA | 62.89000 |
| LogP | 2.17580 |
| Index of Refraction | 1.604 |
| InChIKey | HCTMHJVZTNLVLJ-UHFFFAOYSA-N |
| SMILES | O=C1CCc2c(cccc2[N+](=O)[O-])C1 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2(1H)-Naphthalenone,3,4-dihydro-5-nitro |
| 5-Nitro-2-tetralone |
| 5-nitro-3,4-dihydro-2(1H)-naphthalenone |
| 5-nitro-2-oxo-1,2,3,4-tetrahydronaphthalene |