8'-nitrospiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene]
Modify Date: 2026-08-14 21:29:04
![8'-nitrospiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene] Structure](https://www.chemsrc.com/extcaspic/472/89331-02-2.png)
8'-nitrospiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene] structure
|
Common Name | 8'-nitrospiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene] | ||
|---|---|---|---|---|
| CAS Number | 89331-02-2 | Molecular Weight | 235.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 8'-nitrospiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene] |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H13NO4 |
|---|---|
| Molecular Weight | 235.24 |
| InChIKey | GAVHVZZVLJZWOK-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc2c1CCC1(C2)OCCO1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 8'-nitrospiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene]? |
| A: The English name of 8'-nitrospiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene] is 8'-nitrospiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene]. |
| Q: What is the InChIKey of 8'-nitrospiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene]? |
| A: InChIKey of 8'-nitrospiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene] is GAVHVZZVLJZWOK-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 89331-02-2? |
| A: Chinese name of 89331-02-2 is 89331-02-2. |
| Q: What is the CAS number of 8'-nitrospiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene]? |
| A: CAS number of 8'-nitrospiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene] is 89331-02-2. |
| Q: What is the molecular formula of 8'-nitrospiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene]? |
| A: Molecular formula of 8'-nitrospiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene] is C12H13NO4. |
| Q: What is the SMILES notation of 8'-nitrospiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene]? |
| A: SMILES notation of 8'-nitrospiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene] is O=[N+]([O-])c1cccc2c1CCC1(C2)OCCO1. |
| Q: What is the molecular weight of 8'-nitrospiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene]? |
| A: Molecular weight of 8'-nitrospiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene] is 235.24. |