1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-[1-(4-dimethylaminophenyl)ethylideneamino]oxy-propan-2-ol structure
|
Common Name | 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-[1-(4-dimethylaminophenyl)ethylideneamino]oxy-propan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 89331-51-1 | Molecular Weight | 415.52600 | |
| Density | 1.09g/cm3 | Boiling Point | 579.6ºC at 760 mmHg | |
| Molecular Formula | C23H33N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 304.3ºC | |
| Name | 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-[(E)-1-[4-(dimethylamino)phenyl]ethylideneamino]oxypropan-2-ol |
|---|
| Density | 1.09g/cm3 |
|---|---|
| Boiling Point | 579.6ºC at 760 mmHg |
| Molecular Formula | C23H33N3O4 |
| Molecular Weight | 415.52600 |
| Flash Point | 304.3ºC |
| Exact Mass | 415.24700 |
| PSA | 75.55000 |
| LogP | 3.09450 |
| Index of Refraction | 1.534 |
| InChIKey | IYECXKFLCMTKAP-KOEQRZSOSA-N |
| SMILES | COc1ccc(CCNCC(O)CON=C(C)c2ccc(N(C)C)cc2)cc1OC |
|
~%
1-[2-(3,4-dimet... CAS#:89331-51-1 |
| Literature: Amlaiky; Leclerc; Decker; Schwartz European Journal of Medicinal Chemistry, 1983 , vol. 18, # 5 p. 437 - 439 |
|
~%
1-[2-(3,4-dimet... CAS#:89331-51-1 |
| Literature: Amlaiky; Leclerc; Decker; Schwartz European Journal of Medicinal Chemistry, 1983 , vol. 18, # 5 p. 437 - 439 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |