3-(2,2-diphenylacetyl)-1,3-oxazol-2-one
3-(2,2-diphenylacetyl)-1,3-oxazol-2-one structure
|
Common Name | 3-(2,2-diphenylacetyl)-1,3-oxazol-2-one | ||
|---|---|---|---|---|
| CAS Number | 89332-59-2 | Molecular Weight | 279.29000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(2,2-diphenylacetyl)-1,3-oxazol-2-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H13NO3 |
|---|---|
| Molecular Weight | 279.29000 |
| Exact Mass | 279.09000 |
| PSA | 52.21000 |
| LogP | 2.91360 |
| InChIKey | MZLKTNURJGBPDC-UHFFFAOYSA-N |
| SMILES | O=C(C(c1ccccc1)c1ccccc1)n1ccoc1=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~21%
3-(2,2-diphenyl... CAS#:89332-59-2 |
| Literature: Kunieda, Takehisa; Abe, Yoshihiro; Hirobe, Masaaki Chemistry Letters, 1981 , p. 1427 - 1428 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:1883-32-5This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-diphenylacetyl-2-oxazolone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 3-(2,2-diphenylacetyl)-1,3-oxazol-2-one? |
| A: Molecular formula of 3-(2,2-diphenylacetyl)-1,3-oxazol-2-one is C17H13NO3. |
| Q: What is the molecular weight of 3-(2,2-diphenylacetyl)-1,3-oxazol-2-one? |
| A: Molecular weight of 3-(2,2-diphenylacetyl)-1,3-oxazol-2-one is 279.29000. |
| Q: What are the downstream products of 3-(2,2-diphenylacetyl)-1,3-oxazol-2-one? |
| A: Related downstream products(CAS) of 3-(2,2-diphenylacetyl)-1,3-oxazol-2-one: 1883-32-5. |
| Q: What is the polar surface area (PSA) of 3-(2,2-diphenylacetyl)-1,3-oxazol-2-one? |
| A: Polar surface area (PSA) of 3-(2,2-diphenylacetyl)-1,3-oxazol-2-one is 52.21000. |
| Q: What is the SMILES notation of 3-(2,2-diphenylacetyl)-1,3-oxazol-2-one? |
| A: SMILES notation of 3-(2,2-diphenylacetyl)-1,3-oxazol-2-one is O=C(C(c1ccccc1)c1ccccc1)n1ccoc1=O. |
| Q: What is the InChIKey of 3-(2,2-diphenylacetyl)-1,3-oxazol-2-one? |
| A: InChIKey of 3-(2,2-diphenylacetyl)-1,3-oxazol-2-one is MZLKTNURJGBPDC-UHFFFAOYSA-N. |
| Q: What English synonyms does 3-(2,2-diphenylacetyl)-1,3-oxazol-2-one have? |
| A: English synonyms of 3-(2,2-diphenylacetyl)-1,3-oxazol-2-one: 3-diphenylacetyl-2-oxazolone. |
| Q: What is the LogP of 3-(2,2-diphenylacetyl)-1,3-oxazol-2-one? |
| A: LogP of 3-(2,2-diphenylacetyl)-1,3-oxazol-2-one is 2.91360. |
| Q: What is the Chinese name of 89332-59-2? |
| A: Chinese name of 89332-59-2 is 89332-59-2. |
| Q: What is the CAS number of 3-(2,2-diphenylacetyl)-1,3-oxazol-2-one? |
| A: CAS number of 3-(2,2-diphenylacetyl)-1,3-oxazol-2-one is 89332-59-2. |